Anda di halaman 1dari 16

1

ANALISA ANION
Penyelidikan anion-anion dapat dilakukan menggunakan : 1. larutan asal atau zat padat asal misal: CO32-; Asetat; S2-; borat 2. dari larutan ekstrak soda (E.S) Penggolongan Anion Anion dibagi menjadi 6 golongan : 1. Anion yang ditambah dengan asam encer menghasilkan gas Misal: CO32- ; SO32- ; S2-; S2O32-; HCO3-; HSO3- ; CN-; NO2- ; CN- ; Ac2. Anion- anion golongan oksidator Misal: Fe(CN)6 IO3NO3 3-

CLO3AsO43NO2-

MnO4Cr2O72-

CrO42BrO3-

3. Anion-anion golongan reduktor Misal: SO32S2O32SCN Br3AsO3 Fe(CN)64-

S2INO2-

CNClPO33-

4. Anion-anion golongan AgNO3 a. Anion-anion yang mengendap dalam suasana asam (HNO3 encer)
Misal ClCNS2O32Misal : BrFe(CN)64IO3IFe(CN)63SCNS2-

b. Anion-anion yang mengendap setelah direduksi dengan NaNO2


BrO3- direduksi menjadi BrClO3- direduksi menjadi Cl-

c. Anion-anion yang mengendap dalam suasana netral Misal: PO43- ; HPO42- ; AsO43- ; AsO33- ; C2O42- ; CrO42-

5. Anion anion golongan BaCl2


5.1. Anion yang mengendap dalam suasana asam (HCl) Misal : SO42 S2O82- direduksi dalam HCl menjadi SO42-

2
5.2. Anion mengendap dalam suasana asam setelah dioksidasi dengan Br2 adau I2 Misal : o SO32Diubah menjadi SO422o S2O8 5.3. Anion yang mengendap dalam suasana netral Misal: PO43C2O42AsO33PO33FAsO43CrO42BO33-

6. Anion-anion yang dapat membentuk warna dengan FeCl3


a. Anion anion membentuk warna dalam suasana asam lemah Misal : Fe(CN)64- ; Fe(CN)63- ; SCN- ; Ac-

b. Membentuk warna yang kadang kadang dipertegas dengan FeSO4


Misal :

Fe(CN)63- membentuk warna biru CrO42membentuk warna hijau dari garam Cr3+

PELAKSANAAN ANALISA ANION


Pelaksanaan analisa anion seperti halnya kation dilakukan dalam 3 tahap yakni: 1. Reaksi Pendahuluan 2. Reaksi Penggolongan 3. ReaksiPenetapan

I REAKSI PENDAHULUAN
Dalam reaksipendahuluan dapat digunakan : Zat padat asli Larutan zat asli dalam air Reaksi pendahuluan meliputi antara lain : a. Reaksi nyala api (untuk melihat halogen) Cara : o Garam (halogen) logam halida yang mudah menguap (hijau) Percobaan : Beilstein ( menggunakan kawat Cu/CuO) Cara: CuO + halogen Cu halida ( nyala hijau)

Yang bemberikan tes positif adalah: ClBrO3SCNBrIO3Fe(CN)64ClO3CNFe(CN)63-

Reaksi ini diganggu oleh : Ba2+ dan BO33b. Zat asli ditambah dengan asam sulfat 2N akan membentuk gas Yang bemberikan tes positif adalah:

CaCO3 + H2SO4 Na2SO3 + H2SO4

CaSO4 + CO2 + H2O Na2SO4 + SO2 + H2O

Selanjutnya gas yang timbul diselidiki menggunakan pereaksi yang khas c. Zat diselidiki dalam bentuk padatannya Misal : Asetat ( CH3COO-) ; Borat (BO33-) Asetat:


Borat:

zat padat + H2SO4

CH3COOH + SO42bau cuka CH3COOK + HSO4bau cuka

Zat + KHSO4

Zat padat + H2SO4p + methanol/etanol nyala hijau H2SO4p

Reaksi:

H3BO3 + CH3OH Menarik air

B(OCH3) + H2O nyala hijau

Reaksi ini diganggu oleh : Cu2+ dan Ba2+

d. Penyelidikan anion-anion seperti : S2- ; SO32- ; S2O32- dan SCNCara : reaksi redoks

Zat + Zn + H2SO4 2N

gas Hn Bau telur busuk

Gas Hn+ zat

H2S + Pb(Ac)2

PbS Hitam

Pb asetat

Zat + Zn + H2SO4 2N

Reaksi :

S2- + 2H+ H2S + Pb(Ac)2

PbS + AcHitam

SO32- + 2H+ H2SO3 + 6Hn S2O32- + 2H+ SCN- + H+

H2SO3 H2S + 3H2O H2S2O3 + 6Hn H2S + 3H2O + S Kuning HSCN + 2Hn H2S + HCN

Beberapa anion yang ditemukan dalam penggolongankation adalah:

CrO42Cr2O72MnO4AsO33AsO43-

+ H2S

reaksi redoks

II REAKSI PENGGOLONGAN
Untuk keperluan reaksi penggolongan anion-anion zat yang digunakan dalam bentuk larutan , maka : bila zatnya larut dalam air maka dilarutkan dalam akuades bila zatnya tidak larut dalam air maka dibuat ekstrak soda (E.S) Cara : Zat + Na2CO3 garam CO3 + Na anion (endapan) (filtrat)

Anion dianalisa dari filtrat sedangkan kation dianalisa dari residu larutan E.S 1. Golongan anion-anion yang dengan asam menimbulkan gas Cara: Selidiki dari zat padat/larutan asli dalam air

5
Selidiki zat dari suspensi air Zat yang diselidiki tidak boleh dari E.S karena mengandung garam karbonat

a. Anion-anion jika ditambah H2SO4 encer mengeluarkan gas adalah:


Karbonat Sulfit Asetat Tiosulfat Sulfida Asetat nitrit

b. Anion-anion dengan asam sulfat pekat menimbulkan gas adalah: Oksalat Klorida Bromidaiodida Nitrat Klorat (ClO3-) 2. Anion-anion golongan oksidator Zat + difenil amin + H2SO4p difenilbensidin (biru)

Zat oksidator pada konsentrasi rendah, warna yang terbentuk kurang peka, jika ditambah asam warna menjadi hilang Anion-anion yang termasuk golongan oksidator adalah: NO3H2O2 NO2IO3CrO42BrO3Cr2O72Fe(CN)63MnO4ASO43-

Karenareaksinya oksidari-reduksi maka dapat diganggu oleh kation kation oksidator Misal : Fe3+ dari FeCl3 + difenil amin memberikan warna biru 3. Anion-anion golongan reduktor Reaksi: MnO4- + H+ Violet

Mn2+ + H2O tdk berwarna (encer) / rosa (agak pekat)

Dalam keadaan dingin, KmnO4 harus encer (0,02N) Jika konsentrasi KmnO4 pekat, maka warna KmnO4 setelah reduksi tidak hilang Anion yang memberikan reaksi positif dalam keadaan dingin adalah: S2O32IGrm Fe2+ S2Br\

SO32SCNH2O2

NO2AsO33-

CNFe(CN)64-

Anion anion yang memberikan reaksi positif dalam keadaan panas adalah: Oksalat

6
Formiat

Ion nitrit dan H2O2 dapat positif dengan pereaksi oksidator maupun reduktor karena bersifat baik sebagai oksidator maupun reduktor

4. Anion-anion golongan AgNO3


Anion-anion dengan larutan AgNO3 dapat mengendap baik dalam suasana asam, netral maupun alkali lemah Reaksi : X- + Ag+ AgX

1. Anion-anion yang dengan AgNO3 mengendap dalam suasan asam (HNO3 encer) adalah : ClFe(CN)64CLO3-* IO3CN3Fe(CN)6 Br*) setelah direduksi dengan NaNO2 IS2SCNBrO3-*

2. Anion-anion yang mengendap dengan AgNO3 dalam suasana netral/basa


lemah adalah: PO43C2O42CrO42AsO33AsO43Asetat dalam konsentrasi besar

Na2HPO4 + Ag+ Basa lemah

Ag3PO4 Kuning

H3PO4 (sangat asam) + Ag+

Jika zatnya asam : HCl; H3PO4 ; HNO3 ; H2SO4 ditambahkan AgNO3 + basa sedikit , maka jika mengendap berarti ada HKCl Sedangkan asam HNO3 ; H2SO4 tidak positif pada golongan ini

Reaksi Penggolongan AgNO 3 Zat + HNO3 + AgNO3

Endapan: Cl-; Br-; I-; IO3- ; CN- ; SCN- ; S2-; Fe(CN)64- ; Fe(CN)63Filtrat + NaNO2 + AgNO3

Endapan Br- dari BrO3Cl- dari ClO3-

Filtrat + NaOH netral +HAc 80oC + AgNO3

Endapan : PO43-; AsO33-; AsO43-; CrO42-; C2O42-

Filtrat : buang

Penambahan NaNO2 tidak boleh berlebih (1-2 tetes) karena jika konsentrasi NaNO2 besar , dengan penambahan AgNO3 akan membentuk kristal Reaksi:

BrO3- + NO2- NO2- + Ag+

Br- + NO2AgNO2

Pemanasan 80oC bertujuan untuk melarutkan Agasetat, yangsemestinya adalah Ag2CrO4 (dalam suasana netral), namun penambahan NaNO2 dapat mereduksi CrO42menjadi garam Cr3+

5. Golongan BaCl2:

8
Pereaksi : BaCl2 / BaNO3 Hasil reaksi : endapan berwarna atau tidak berwarna Anion-anion dapat mengendap dengan BaCl2 dalam suasana asam dan netral

Anion-anion yang mengendap dalam suasana asam kuat adalah: SO42 S2O32setelah dioksidasi dengan Br2 menjadi SO422 SO3 Anion anion yang mengendap dalam suasana netral adalah: CrO42 PO43 AsO43 BrO3 C2O42- dapat mengendap dalam suasana netral , namun konsentrasinya harus cukup besar

Reaksi Penggolongan BaCl 2


Zat + HCl + BaCl2

Endapan: SO42-

Filtrat + Br2/I2 + BaCl2

Filtrat Endapan: SO dari S2O32- ; SO3224

+ NaAc (netral + BaCl2

Endapan: CrO42-;
334

Filtrat
3-

PO4 ; AsO ; BO3

+ CaCl2

Filtrat Endapan: C2O4


2-

6. Golongan FeCl3 /FeSO4


Anion-anion yang memberikan reaksi warna dengann FeCl3 adalah :

Fe(CN)64CH3COO- (asetat) HCOO- (formiat) SCNBO33-

Anion anion yang memberikan warna dengan FeCl3 dalam suasana asam tidak kuat adalah: Fe3+ + Fe(CN)64- KFeFe(CN)6 (biru berlin)

Fe3+ + CH3COOFe3+ + SCN

Fe(CH3COO)3 (merah-coklat) Fe(SCN)2+ (merah darah)

Bila ada bisulfit (H2SO3 ; S2-) maka akan bereaksinsebagai:

Fe3+ + S2-

Fe2S3

Jika ada ion Fe2+ dapat berelsi membentuk warna sebagai:

Fe2+ + Fe(CN)63-

Fe3[Fe(CN)6]2

III. REAKSI PENETAPAN ANION


Pada umumnya anion anion dengan asam (kuat maupun lemah) menimbulkan gas yang terlihat sebagai gelembung-gelembung Jika konsentrasi nya terlaluencer seringkali gelembung yang keluar tidak jelas Adanya gelembung dapat dilihat secara langsung menggunakan mikroskop/gelas obyek Anion anion yang menimbulkan gas dengan asam adalah: CO32NO3HCO3NO2SO32CLOHSO3CNS2O32OCNS2-

10 1. Reaksi Penetapan CO 32-/HCO 3 Pada reaksi pendahuluan dengan larutan Ba(OH)2 atau Ca(OH)2 terbentuk endapan
putih Reaksi :


Cara :

CO32- + H+

CO2 + H2O BaCO3 Putih + H2O

Ba(OH)2 + CO2

Ba(OH)2 + CO2

+ H+

Ba(HCO3)2 Larut

Ba(OH)2 atau Ca(OH)2 Zat + H2SO4/HCl Reaksi ini juga diberikan oleh ion sulfite:

SO32- + H+

SO2 + H2O Ba(HCO3)2 larut

Ba(OH)2 + SO2 + H2O

Cara membedakan ion karbonat dan sulfit: a. Melihat golongan reduktor Sulfit (+) Karbonat (-) b. Melihat golongann BaCl2 Sulfit (+) Karbonat (-)

c. Zat + H2SO42N + K2Cr2O7


Sulfit ( + ) larutan menjadi hijau Karbonat (-) , larutan menjadi keruh

Reaksi: SO32- + Cr2O72SO42- + Cr3+ (hijau)

Cara membedakan HCO3- dengan CO32-:

11
1. zat tunggal, menggunakan indikator universal (cocokkan dengan literatur) 2. dengan garam MaSO4:

CO32- + Mg2+ HCO3- + Mg2+

MgCO3 Putih Mg(HCO3)2 (larut)

Mg(HCO3)2

MgCO3 + H2O + CO2 putih

3. dengan HgCl2 (sublimat)

4 CO32- + 4Hg2+ HCO3- + Hg2+

Hg4O3CO3 + 3CO2 Merah coklat

2. Reaksi Penetapan SO 32-/HSO 3


Golongan reduktor (+) Golongan BaCl2 (+) Golongan mengeluarkan gas (+)

Cara : a. Kertas saring dibasahi dengan larutan K2Cr2O7 (oranye) diletakkan di mulut tabung reaksi yang berisi zat yang telah diasamkan dengan H2SO42N, akan berbah menjadi hijau K2Cr2O7 Cr2O72- + SO2 + 10H+ Zat + H2SO4 2N 2Cr3+ + SO42- + 5H2O Hijau (kertas saring)

b. Kerats saring yang telah dibasahi dengan KIO3 dan amilum akan berubah
menjadi biru reaksi :

IO3- + 2SO2 I2 + amilum

I2 + SO42Iod- amilum (biru)

c. Bau merangsang seperti belerang, tidak berwarna (gas SO2)


Cara membedakan SO 32- dengan HSO 3- :

12
Dengan kertas indikator universal Dengan BaCl2 maka:

SO32- + Ba2+

BaSO3 Putih

HSO3- + Ba2+

Ba(HSO3)2 ( larut)

3. Reaksi Penetapan ion tiosulfat (S 2O 32-)

Reaksi:

Golongan reduktor (+) Golongan BaCl2 (+) Golongan mengeluarkan gas (+)

S2O32- + H+

SO2 + H2O + S Kuning

SO2 + K2Cr2O7 + 10H+ SO2 + IO3- + amilum

SO42- + 2Cr3+ biru

Cara membedakan ion S2O32-; SO32- dan CO32- :

Larutan + I2 + amilum Biru

warnanya hilang

Reaksi ini positif jika ada ion sulfit dan tiosulfat ( ditandai adanya endapan kuning muda dari belerang)

4. Reaksi Penetapan ion sulfida:

Golongan reduktor (+) Dengan asam H2SO4 encer menghasilkan gas H2S yang dapat menghitamkan kertas Pb asetat H2S + Pb(Ac)2 PbS

Reaksi : S2- + 2H+ Reaksi :

S2- + 2H+

H2S + AgNO3

Ag2S Hitam

H2S + HgCl2

HgS Hitam CdS Kuning

H2S + Cd(Ac)2

13
Sulfida sulfida kation golongan II tidak larut dalam asam encer, sehingga jika ditambah asam encer tidak menimbulkan gas H2S Ciri khas gas H2S: Gas tidak berwrna Bau telur busuk Menghitamkan kertas saring yang dibasahi dengan Pb asetat

Reaksi warna yang peka untuk sulfida adalah:

Pb2+ + H2S

PbS + 2H+ Hitam

Dengan larutan Na.nitroprusid ( Na2Fe(CN)5NO) dalam alkali NaOH menghasilkan warna ungu/violet Sulfida harus dalam bentuk garam yang larut dan bereaksi basa, jika tidak maka reaksinya negatif Reaksi dengan Na nitroprusid ini sangat peka dan dapat menunjukkan adanya sulfida dalam jumlah kecil Reaksi: Na2Fe(CN)5NO + Na2S NaFe(CN)5NOS Ungu

Larutan zat + NaOH + reagen (dalam air)(baru)

ungu

Untuk sulfida yang sukar larut (HgS) diidentifikasi menggunakan

reaksi Gutzeit

AgNO3 H2S Kapas PbAsetat

Zat + H2SO4 2N 5. Reaksi Penetapan ion Nitrit

14
Dengan asam encer menimbulkan gas NO2 berwarna coklat , bau merangsang Golongan oksidator (+) Golongan reduktor (+) Kertas KI-amilum biru

NO2- + H2SO4 2N
Reaksi:

NO2

Tb I

HNO2

NO + HNO3 + H2O

udara NO + (O)

NO2 (coklat)

Dengan larutan FeSO4 pekat + H2SO4 encer/ Hac encer reaksi cincin coklat

Alirkan pelan-pelan melalui dinding tabung I terbentuk cincin coklat

Larutan FeSO4pekat + HAc NO2- encer


Reaksi: 2NaNO2 + 2Hac 2HNO2 FeSO4 + NO 2 Na Ac + 2HNO2 NO + HNO3 + H2O Fe(NO)SO4 Coklat

Reaksi ini diganggu oleh ion-ion yang memberikan warna dengan Fe2+ misal Fe(CN)63dan I-

I- + 2NO2 + 4H+ I2 + NO + 2H2O Coklat Fe(CN)63- + Fe2+ Fe3[Fe(CN)6]2

15
Biru

6. Reaksi Penetapan Ion Nitrat


Reaksi penetapan untuk ion nitrat antara lain adalah: 1. Reaksi cincin coklat dengan pereaksi FeSO4 encer dan H2SO4 pekat H2SO4 pkt pelan-pelan sehingga membentuk 2 lapisan

Reaksi

NO3- + FeSO4 Bila ada nitrit tidak (+) dan seluruh larutan berwarna coklat , sehingga nitrit mengganggu penentuan nitrat

NaNO3 + H2SO4 p

NaHSO4 + HNO3 3Fe2(SO4)3 + 2 NO + 4H2O

6FeSO4 + 2HNO3 + 3 H2SO4 FeSO4 + NO

Fe(NO)So4 Coklat Ion nitrat tidak mengganggu penentuan nitrit Ion nitrit mengganggu penentuan nitrat

2. dengan reaksi diazo

nitrat dengan asam sulfanilat dan naftilamin dan asam asetat menimbulkan warna merah di papan tetes

Cara membedakan ion nitrit dan nitrat: Zat NO2NO3H2SO42N + Oksidator + + Reduktor + FeSO4HAc + FeSO4/H2SO 4 ++ + KI-Hac I2 + -

Cara menghilangkan nitrit: a. direduksi dengan urea dan H2SO4 encer menjadi gas N2 reduksi NO2N2

(NH2)2C=O + 2NO2- + 2H+

CO2 + N2 + H2O

b. ditambah aam amina sulfat/NH2SO3H

16
Kristal ditambahkan pada campuran NO3- dan NO2- , dipanaskan menghasilakn gas N2 NH3-SO3H +H+ + NO3- N2 + H2SO4 + H2O

Disini terjadi oksidasi-reduksi SO3- menjadi SO42-

c. dengan NH4Cl

NO3- + NH4Cl

N2 + Cl- + H2O

Paling baik adalah reaksi (b) karena tidak ada hasil samping, sedangkan reaksi (a) dan (c) sebagaian nitrit dioksidasi menjadi nitrat