Anda di halaman 1dari 9

ANALISIS KUALITATIF SENYAWA ANORGANIK Tahapan Analisis A. Analisa Pendahuluan 1. Pemeriksaan organoleptis 2. Reaksi nyala api 3.

Reaksi pemijaran 4. Reaksi untuk zat yang mudah menguap/menyublim 5. Sifat zat pada penambahan H2SO4 dan NaOH 6. Kelarutan zat 1. Pemeriksaan Organoleptis - Warna zat Hitam : PbS, CuS, Ag2S, dll Biru : garam Cu terhidrat, garam Co anhidrat Hijau : garam Fe2+, Ni2+, Cr3+ Merah : HgI2, PbO2, K3[Fe(CN)6] Pink : garam Mn(II), garam Co(II) terhidrat Kuning : AgI, PbI2, CdS, FeCl3 Putih : MgO, ZnO, CaO Coklat : Fe2O3, SnS, Fe(OH)3 - Bentuk Kristal (dilihat dengan mikroskop) Jarum : CaSO4, H2O Kubus : AgCl Amorf : SrSO4 - Sifat Higroskopis Mempunyai sifat higroskopis : NaCl. CaCl2, FeCl3 - Bau Zat berbau khas : Bau amoniak : garam NH4+ Bau cuka : garam asetat Bau belerang : garam sulfit Bau telur busuk : garam sulfide Bau gas oksida nitrogen : garam nitrat/nitrit 2. Reaksi Nyala Api Cara: Kawat NiCr dibasahi HCl pelat, nyala bunsen, zat + HCl encer pijarkan. Warna nyala Zat Kuning emas Na Lembayung muda K (dengan kaca Cobalt) Merah bordo Sr Sindur merah Co Merah bata Ca Hijau kuning Ba Hijau terang B Hijau kebiruan Cu Biru lemah Pb Kelabu biru lemah As, Sb, bi Reaksi Belstein (dengan kawat Cu) halogen dan N (nyala hijau).

3.

4.

Reaksi Pemijaran/Pemanasan Kering a. Zat tidak terurai - Tidak terjadi perubahan warna ex: CaO, MgO, BaSO4 - Terjadi perubahan warna ex: ZnS : dingin putih panas kuning PbO : dingin kuning panas merah coklat b. Zat terurai : terjadi perubahan warna ex: FeCl3.6H2O: hijau kuning CoCl2.6H2O: merah karmija biru NiSO4.7H2O: hijau kuning c. Zat melumer ex: NaOH, NH4NO3, Bi2O3, CaCl2.6H2O, ZnSO4.7H2O d. Zat menyublim ex: - garam NH4+, As2O3, garam klorida dari Al, Hg, Zn, Sr, Pb warna putih - S, HgI2, PbI2 warna kuning - I2 dari garam I dan IO3- tercampur asam warna ungu - As, Hg kelabu - HgS, FeCl3 hitam e. Zat mengeluarkan gas - Tidak berbau dan tidak berwarna ex: O2 dari garam peroksida dan oksida N2O dari NH4NO3 atau nitrat N2 dari NH4NO3 CO2 dari garam karbonat, hidrogen karbonat, asam organik - Tidak berwarna, berbau khas ex: NH3 dari garam amonium SO2 dari garam sulfit dan tiosulfat SO3 dari garam sulfat - Berwarna dan berbau keras ex: I2 (violet) dari garam iodida Br2 (coklat) dari garam bromida Cl2 (kuning) dari garam klorida NO2 (coklat) dari garam nitrat/nitrit Reaksi untuk zat yang mudah menguap / menyublim NH4+ NaOH 4N - Bau Amoniak - Lakmus merah biru - HCl kabut putih - +reagen Nesler coklat hitam Asetat : zat digerus dengan K/NaHSO4 : bau cuka Borat : zat +H2SO4 pekat +alkohol nyala hijau Hg2+ & Bi 3+ oembentukan amalgam dengan kawat Cu As3+ & Sb3+ : reaksi Gutzeit & Fleitman Ion Halogen : kawat Cu dikenakan zat, dibakar pada nyala Bunsen nyala hijau

B. PENGGOLONGAN dan REAKSI SPESIFIK ANION Penggolongan ANION 1. Anion Pereduksi SO3+ NO2ICNS2O32CNSAsO33ClS2BrFe(CN)642. Anion Pengoksidasi NO3BrOCr2O72AsO43NO2IO3MnO4ClO3CrO42Fe(CN)633. Golongan Perak Nitat Cl AgCl (p) Br AgBr (k) I AgI (k) IO3 AgIO3 (p) CNS AgCNS (p) 4Fe(CN)6 Ag4Fe(CN)6 (p) 3Fe(CN)6 Ag3Fe(CN)6 (jg) 2S Ag2S (ht) 4. Golongan BaCl2 Larutan + HCl encer +BaCl2 mengendap SO42 BaSO4 5. Golongan FeCl3 Larutan + HCl encer + FeCl3 endapan / warna Endapan coklat / kuning CrO42-, AsO43-, PO43-, B4O72REAKSI PENETAPAN ANION Klorida (Cl-) - Cl- + Ag+ AgCl P AgCl + 2NH3 [Ag(NH3)2]Cl + 2H+Ag + 2NH4+ larut ht Bromida (Br-) - 6Br- + Cr2O7 2- + 14H+ 3Br2 + 2Cr3+ + 7H2O - Br2 + CHCl3 kuning coklat (lar) Iodida (I-) - I- + Ag+ AgI kuning - 6I + Cr2O7 + 14 H+ 3I2 + 2 Cr3+ + 7H2O - I2 + CHCl3 violet
2-

Tiosianat (rodanida) - Fe3+ + 3CNSFe(CNS)3 (merah darah) 3+ - Fe + 6CNS [Fe(CNS)6]3 Klorat (ClO3-) - ClO3- + 3H2SO3 Cl- + 3H2SO4 - ClO3- + Ag+ AgCl

- 2ClO3- + H2SO4 HClO3 (As. Klorat) + SO42HClO4 + ClO2 + H2O (As. Perklorat) Cl2 2O2 Bromat - BrO3- + 6I- + 7H+ 3I2 + HBr + 3 H2O + amilum biru Iodat - IO3- + 5I- + 6H+ 3I2 + 3 H2O + amilum biru Kromat dan Bikromat (CrO42- & Cr2O72-) - Garam kromat : kuning - Garam bikromat : jingga - Ba2+ + CrO42 BaCrO4 kuning 2+ - CrO4 + H2SO4 + H2O2 Amil alkohol CrO(O2)2 2+ - Cr2O7 biru (krom peroksida) Permanganat - 2MnO4- + 5H2O2 + 6H+ 2Mn2+ + 5O2 + 8H2O ungu tidak berwarna Nitrat - 3Fe2+ + NO3- + 4H+ 3Fe3+ + NO +2H2O 5H2O [Fe(H2O)5NO]SO4 - FeSO4 + NO + cincin coklat Nitrit

Sulfat 22+ - SO4 + Ba BaSO4 putih (tidak larut dalam HCl)

Sulfit I2 + H2O + SO32- 2I- +2H+ + SO42+ hilangnya warna Tiosulfat - S2O32- S + SO2 + H2O kuning Sulfida - S2- + 2H+ H2S H2S + Pb2+ PbS + 2H+ hitam Fosfat - Zat + asam nitrat + amonium molibdat PO43- + 12[MoO4]2- + 2H+ +3NH4+ (NH4)3[P(Mo3O10)4].H2O kuning Arsenat - AsO43- + 2I- + 2H+

AsO33- + I2 + H2 biru + amilum

Fero amonium sulfat - Cu2+ + [Fe(CN)6]4- Cu[CuFe(CN)6] + K+ merah coklat

Ferri amonium sulfat - 3Cu2+ + 2[Fe(CN)6]3- Cu[CuFe(CN)6]2 hijau Karbonat dan Hidrogen karbonat - Perbedaan protolisisnya dalam air - HCO3- + H2O H2O+ + CO32(+ pp tidak berwarna/merah lemah) - Na2CO3 + H2O Na+ + NaHCO3 + OH(+ pp merah kuat) C. PENGGOLONGAN dan REAKSI SPESIFIK KATION a. Penggolongan Kation a.l. : Metoda H2S oleh Bergmann Metode ini tidak dilakukan dalam praktikum. b. Reaksi Spesifik untuk Kation GOLONGAN I (GOLONGAN PERAK Pb2+ ; Ag+ ; Hg2+ ; Pb2+) Pb2+ Larutan + CrO42- asetat PbCrO4 2+ (Pb ) kuning Reaksi Kristal Pb2++ HCl 2N

larut,

dinginkan PbCl2 putih

Pb2+ + lar. KI

PbI kuning

Ag+ Larutan + Cl (Ag+)

AgCl

HNO3

tidak larut
encer

putih + NH4OH [Ag(NH3)2 ]+ (larut) + Ag + NH3 + HCOH + H2O 2 Ag + HCOOH + NH3 + NH4+ Cermin perak Hg2+ Hg2+ + kawat Cu Hg + Cu Cl2 (abu abu mengkilat)
I Hg2+ + I- HgI2 K2HgI4 (merah orange) (larut)

GOLONGAN II (GOLONGAN TEMBAGA & ARSEN) IIA : Hg2+, Bi3+, Pb2+, Cu2+, Cd2+ IIB : Sn2+, As3+, Sb3+ Bi3+ Bi3++H2O+HCl BiOCl+2HCl (putih) Bi3++larutan chinconinan nitrat-KI jingga Cu2+ Cu2++K4 (Fe(CN)6) Cu2(Fe(CN)6) larut NH4OH encer kebiruan (Cu(NH3))2+ +NH4OH Cd2+ Cd2+ + (NH4)2(Hg(CNS)4)Cd(Hg(CNS)4) [K2(Hg(CNS)4] Kristal Sn2+ Sn2++NaOH berlebih

Cu2++ NH4OH Cu(OH)2+NH4+

Na2(SnO2)+H2O Bi3+ + NaOH

Bi+H2O+NaNO2+Na2(SnO3) Hitam metalik

As3+/As5+ A. Reaksi gutzeit

Reaksi : As3++Zn+H+ AsH3++Zn2++H2O AgNO3+AsH3 Ag+HNO3+H3AsO3 hitam B. Reaksi Fleitman Reduktor : Al dalam KOH/NaOH Reaksi : As3++Al+OH- AsH3+4[Al(OH)4]Dst=gutzeit Gutzeit Fleitman As + + Sb + AsAg3 AgNO3+HNO3 Kuning+H2O

Golongan IIIA (Gol. Besi) dan IIIB (Gol. seng) IIIA : Fe2+ , Fe3+ , Cr3+ , Al3+ Pereaksi K4 Fe(CN)6 K3Fe(CN)6 NH4CNS/KCNS NH4OH Fe2+ Endapan putih Endapan biru tua Tak berwarna Endapan putih hijau Fe3+ Endapan biru berlin Larutan coklat Larutan merah darah Endapan merah coklat

Al3+ Al3+ + NH4OHAl(OH)3+NH4+ Al3+ + pereaksi morin/netral larutan koloid berflouresensi hijau Cr3+ Cr3+ + NaOH berlebih +H2O2larutan kuning Cr3++NaOH Cr(OH)3+Na+ Cr(OH)3+NaOHNaCrO2+H2O NaCrO2+H2O2 Na2CrO4+H2O (kuning) Na2CrO4+Pb(CH3COO)2PbCrO4 (kuning)

IIIB : Co2+, Ni2+, Mn2+, Zn2+ Co2+ Co2+ + NH4CNS (NH4)2[Co(CNS)4] + NH4NO3 biru + amil alkohol Co2+ + (NH4)2 [Hg(CNS)4] Co[Hg(CNS)4] Kristal biru muda Ni2+ Ni2+ + CH3-C=N-OH I CH3-C=N-OH +
NH4OH

NH4+ + H2O +

Ni-DMG (merah)

Mn2+ Mn2+ + NaOH Mn(OH)2 Putih Mn(OH)2 + O2 + H2O Mn(OH)3 Coklat Zn2+ Zn2+ + K4[Fe(CN)6] K2Zn3 [Fe(CN)6]2 Putih kehijauan 2+ Zn + (NH4) [Hg(CNS)4] Zn[Hg(CNS)4] kristal GOLONGAN IV (Gol. Kalsium) Ba2+, Sr2+, Ca2+ Ba2+ Ba2+ + Na Rhodizonat noda merah coklat HCl encer tetap Ba2+ + H2SO4 encer BaSO4 (tidak larut dalam asam encer dan HNO3 pekat) Putih Sr2+ Sr2+ + H2SO4 encer SrSO4 (tidak larut dalam (NH4)2SO4 panas) Sr2+ + Na Rhodizonat noda merah coklat HCl encer noda hilang Ca2+ Ca2+ H2SO4 encer CaSO4 (larut dalam (NH4)2SO4 panas) Putih (kristal jarum) GOLONGAN V (Golongan Sisa): K+, Na+, NH4+, Mg2+ K+ K+ + Tripel Nitrit A + Tripel Nitrit B Kristal kotak hitam K+ + HClO4 KClO4 + HCl Putih Na+ Reaksi nyala api Na+ + 3UO2(CH3COO)2 + Zn(CH3COO)2 + CH3COOH + H2O NaZn(UO2)2(CH3COO)9.9H2O + H+ Kristal kuning (bentuk diamond)

NH4+ NH4+ + NaOH NH3 + H2O Lakmus Lakmus merah menjadi biru +NaOH + NH4 + K2HgI4 NHg2I.H2O + H2O + K+ + I(Nesler) coklat Mg++ Mg++ + NH4Cl + NH4OH + Na2HPO4 (sama-sama basa) kristal spesifiK