Anda di halaman 1dari 33

SWEETDRACO (sweet dragon fruit skin with chocolate

)
disusun untuk memenuhi tugas mata kuliah Pengembangan Produk Baru

LAPORAN PENGEMBANGAN PRODUK BARU

Oleh:
Kelompok 5 / THP-B
1. Bagus Ananda

(131710101038)

2. Novila Santi Lovabyta

(131710101050)

3. Elok Bashirah Yuliana

(131710101090)

4. Istiqomah Alfulaili

(131710101114)

JURUSAN TEKNOLOGI HASIL PERTANIAN
FAKULTAS TEKNOLOGI PERTANIAN
UNIVERSITAS JEMBER
2016

BAB 1. PENDAHULUAN

1.1. Latar Belakang
Manisan adalah salah satu bentuk makanan olahan yang banyak disukai oleh
masyarakat. Rasanya yang manis bercampur dengan rasa khas buah sangat cocok
untuk dinikmati di berbagai kesempatan. Buah-buahan terutama berfungsi sebagai
sumber vitamin dan mineral, tetapi pada jenis buah-buahan tertentu dihasilkan
juga cukup banyak energi. Energi ini berasal dari gula yang digunakan dalam
pembuatan manisan. Gula berfungsi sebagai pemberi rasa juga sebagai agen
antimikroba dalam konsentrasi yang tinggi, selain itu adanya penambahan asam
sitrat sebagai perasa (masam) dan agen antimikroba yang dapat menambah
keawetan produk.
Salah satu buah yang digunakan dalam pembuatan manisan adalah buah
naga. Buah naga (dragon fruit) merupakan tanaman buah yang banyak
dibudidayakan di Indonesia saat ini. Jenis buah naga yang banyak dibudidayakan
adalah buah naga merah (Hylocereus polyrhizuz). Salah satu perkebunan buah
naga merah terbesar di Pulau jawa adalah di Kabupaten Banyuwangi. Produksinya
mencapai 12.936 ton pada tahun 2012 dan akan terus meningkat di tahun-tahun
berikutnya (BPS Kabupaten Banyuwangi, 2013).
Bagian yang paling banyak dimanfaatkan dari buah naga adalah daging
buahnya. Kulit buah naga masih belum banyak dimanfaatkan, padahal berat kulit
buah naga sebesar 30-35% dari berat buah keseluruhan (Saati, 2009). Hal ini tentu
mengakibatkan banyaknya limbah kulit buah naga, padahal kulit buah naga merah
mengandung senyawa fungsional yaitu pigmen betasianin. Kandungan betasianin
pada kulit buah naga merah ± 150,46 mg/100 g. Disamping itu, kulit buah naga
merah juga mengandung pektin yang tinggi, yaitu sebesar 10,79% (Jamilah et al.,
2011).
Melihat potensi bahan baku yang berlimpah dengan kandungan fungsional
tersebut, maka sangat memungkinkan untuk dikembangkannya produk manisan
berbahan baku kulit buah naga merah. Inovasi yang akan dilakukan bukan hanya
dari segi penggunaan bahan baku, namun juga dari segi penyajian dan kemasan.

Manisan yang dihasilkan akan dilapisi dengan coklat, sehingga selain dapat
menambah daya tarik produk juga menambah nilai fungsional produk. Produk
yang dikembangkan ini dapat menambah variasi snack fungsional yang baik untuk
masyarakat.

1.2. Tujuan
Tujuan pemilihan produk sweet dragon fruit skin with chocolate pada
pengembangan produk manisan yaitu:
a) Pemanfaatan limbah kulit buah naga merah untuk meningkatkan nilai
ekonomis.
b) Pengembangan bahan baku lokal yaitu buah naga merah dan sebagai upaya
peningkatan nilai gizi.
c) Mengetahui respon pasar terkait produk sweetdraco.
d) Menganalisis kelayakan industri sweetdraco jika diterapkan dalam skala yang
lebih besar.

Menurut penelitian Wu et al. Pasuruan dan daerah lainnya (Kristanto.03%.1. flavonoid.1 Analisis Bahan Baku 2. terpenoid. 2008). alkaloid. Namun buah naga saat ini telah dibudidayakan di Indonesia seperti di Jember. Selain itu aktivitas antioksidan pada kulit buah naga lebih besar dibandingkan aktivitas antioksidan pada daging buahnya. sedangkan pada daging buah naga hanya mampu menghambat radikal bebas sebesar 27. karoten.481. kelembaban udara. 2. Gula dapat berfungsi sebagai .836 μ g/mL.3:2010.1. Pertumbuhan buah naga dipengaruhi oleh suhu. vitamin A. kobalamin. 2009). keadaan tanah dan curah hujan. Malang.02% radikal bebas. dan fitoalbumin (Jaafar et al. (2006) keunggulan dari kulit buah naga yaitu kaya polifenol dan merupakan sumber antioksidan.BAB 2. niasin. piridoksin. Kulit buah naga mengandung vitamin C. Hal ini sesuai dengan penelitian yang dilakukan oleh Nurliyana et al.455. fenolik. Habitat asli buah naga berasal dari negara Meksiko. gula kristal putih adalah gula kristal yang dibuat dari tebu atau bit melalui proses sulfitasi/ karbonatasi/ fosfatasi atau proses lainnya sehingga langsung dapat dikonsumsi. Amerika Utara dan Amerika Selatan bagian utara. Penggunaan gula dalam pengolahan secara umum berfungsi untuk mengawetkan bahan. tiamin.vitamin E.2 Gula Menurut SNI 3140. sehingga berpotensi untuk dikembangkan menjadi sumber antioksidan alami. (2010) yang menyatakan bahwa di dalam 1 mg/ml kulit buah naga merah mampu menghambat 83. Selain itu aktivitas antioksidan kulit buah naga juga didukung dengan penelitian oleh Mitasari (2012) yang menyatakan bahwa ekstrak kloroform kulit buah naga merah memiliki aktivitas antioksidan dengan nilai IC 50 sebesar 43. TINJAUAN PUSTAKA 2.. menghasilkan citarasa dan memperoleh sifat tertentu yang dikehendaki.1 Kulit Buah Naga Buah naga merupakan tumbuhan yang berasal dari daerah beriklim tropis kering.

Gula memiliki citarasa manis sehingga penggunaan gula dalam pengolahan juga memberikan efek citarasa manis pada produk yang dihasilkan. asam 2hidroksi-1. sehingga asam sitrat hasil ektraksi dari buah-buahan ini dikenal sebagai asam sitrat alami. Asam sitrat diproduksi dalam bentuk kristal dan memiliki kreteria yang tidak berwarna. Keasaman Asam Sitrat didapatkan dari tiga gugus karboksil COOH yang dapat melepas proton dalam larutan.2. 1997).3-propanatrikarboksilat.1. berasa asam. 1999). Komposisi Zat Gizi Gula Pasir per 100 g Zat gizi Kandungan Energi (kkal) 364 Protein (g) 0 Lemak (g) 0 Karbohidrat (g) 94 Kalsium (mg) 5 Fosfor (mg) 1 Sumber : Darwin (2013) 2. Proses pemanasan juga menyebabkan terjadinya karamelisasi gula yang membentuk citarasa (Praptiningsih.1 Asam Sitrat Asam sitrat adalah asam organik yang secara alami terdapat pada buahbuahan seperti jeruk. 1997). Asam sitrat pertama kali diekstraksi dan dikristalisasi dari buah jeruk. struktur asam ini tercermin pada nama IUPAC-nya. Rumus kimia Asam Sitrat adalah C6H8O7 atau CH2(COOH)-COH(COOH)CH2(COOH). gula berperan dalam membentuk tekstur yang kuat dan warna yang mengkilap. Pada pembuatan manisan. nanas dan pear. . tidak berbau dan lebih cepat larut dalam air panas (Winarno. Jika hal ini terjadi.pengawet karena adanya gula Aw bahan mengalami penurunan. Di samping itu adanya proses pemanasan gula akan bereaksi dengan asam amino dan menghasilkan citarasa. ion yang dihasilkan adalah ion sitrat (Winarno. sehingga air yang ada tidak dapat digunakan untuk pertumbuhan mikroba.

Asam sitrat akan memungkinkan sabun dan deterjen membentuk busa dan berfungsi dengan baik tanpa penambahan zat penghilang kesadahan. pengatur pH dan sebagai pemberi kesan rasa dingin. sedangkan sisanya digunakan dalam industri pemacu rasa. pengawet. Sifat sitrat sebagai larutan penyangga digunakan sebagai pengendali pH dalam larutan pembersih dalam rumah tangga. dan dalam resep makanan asam sitrat dapat digunakan sebagai pengganti sari jeruk. dan 30% digunakan dalam industri farmasi. asam sitrat digunakan sebgai pemacu rasa. Struktur Molekul Asam Sitrat Asam sitrat (C6H8O7) banyak digunakan dalam industri terutama industri makanan. penghasil warna gelap dan penghelat ion logam. Asam sitrat juga digunakan untuk memulihkan bahan penukar ion yang digunakan pada alat penghilang kesadahan dengan menghilangkan ion-ion logam yang terakumulasi pada bahan penukar ion tersebut sebagai kompleks sitrat. Dengan mengikat ion-ion logam pada air sadah. dan obat-obatan. Dalam industri farmasi asam sitrat digunakan sebgai pelarut dan pembangkit aroma. penginversi sukrosa.Gambar 1. sebagai antioksidan. Dalam industri makanan dan kembang gula. 1994). sedangkan pada industri kosmetik digunakan sebagai antioksidan (Bizri dan Wahem. Kemampuan Asam sitrat untuk mengikat ion-ion logam menjadikannya berguna sebagai bahan sabun dan deterjen. minuman. Asam sitrat dapat pula ditambahkan pada es krim untuk menjaga terpisahnya gelembung-gelembung lemak. pencegah rusaknya rasa dan aroma. Kurang lebih 60% dari total produksi asam sitrat digunakan dalam industri makanan. Asam sitrat .

2. dan pada cokelat juga merubah kristalisasi serta memacu terjadinya gejala blooming maupun produk cokelat yang lembek. Dengan demikian. yang terdiri dari hidrogen dan oksigen dengan rumus kimiawi H2O.dikategorikan aman digunakan pada makanan oleh semua badan pengawasan makanan nasional dan internasional utama (Winarno. Menurut Williams et al. (1997) suatu campuran bisa saja diperoleh tanpa memperhatikan sifat lemak. maka zat-zat yang paling alamiah maupun buatan manusia hingga tingkat tertentu terlarut di dalamnya.2 Air Air adalah zat cair yang tidak mempunyai rasa. 1997). Menurut Lipp dan Anklam (1998). pada proses pencetakan tanpa tempering. Sifat air yang dapat melarutkan zat-zat yang memiliki kepolaran yang sama sering dimanfaatkan dalam kehidupan sehari-hari seperti pembuatan produk pangan maupun non pangan (Linsley dan Franzini. 2010). .3 Cokelat Susu (Batang) Produk hasil olahan kakao memiliki sifat yang spesial dari pangan lainnya. 1991).1. 2. bukanlah karena rasa dan nutrisinya yang baik. warna dan bau. (Indarti dan Arpi. Pada formulasi yang sama. Air merupakan suatu larutan yang hampir-hampir bersifat universal. rapuh saat dipatahkan dan meleleh sempurna pada suhu tubuh (Lip dan Anklam. cokelat batang memiliki titik yang lebih rendah dibandingkan pencetakan tempering. akan tetapi disamping merubah karakter lemak. Daerah asal kakao akan ikut mempengaruhi komponen pembentuk lemak. air di dalam mengandung zat-zat terlarut. 1998). keadaan tersebut dapat memicu terjadinya pergerakan lemak (fat migration) di dalam sistem multi komponen. serta proses tempering.1. tetapi lebih karena sifatnya yang tidak dimiliki oleh pangan lain yaitu bersifat padat di suhu ruang. lemak kakao mempunyai tingkat kekerasan (pada suhu kamar) yang berbeda-beda tergantung dari daerah asal kakao tersebut tumbuh. Produk olahan sekunder yang paling mudah diperoleh yaitu cokelat batang.

sehingga dapat menurunkan laju respirasi dan memperkecil . patah kurang sempurna. (1989). pemberian CaCl2 dapat membentuk ikatan silang antara Ca2+ dengan asam pektat dan polisakarida-polisakarida lain sehingga membatasi aktivitas enzim–enzim pelunakan dan respirasi seperti poligalakturonase. 2012). Cokelat yang digunakan sebagai coating umumnya adalah milk chocolate compound atau cokelat batangan yang berwarna cokelat yang merupakan campuran gula. leleh pada suhu tubuh (37°C) VI 36°C (97°F) Keras. Pemberian CaCl2 sebagai bahan tambahan pangan (BTP) juga menguntungkan sebeb kalsium (Ca2+) juga dapat memperpanjang daya simpan dengan memperlambat pemasakan buah. Garam ini merupakan elektrolit kuat. cokelat digunakan sebagai pelapis atau coating. sehingga mudah larut dalam air dan ion-ion Ca mudah terabsorbsi ke dalam jaringan yang mengakibatkan dinding sel makin kuat. 1973). 2. sulit mencair Sumber: Susanto (1994) Penggunaan cokelat dapat disesuaikan dengan kebutuhan. sehingga menghambat hidrolisis atau pemecahan. cokelat cair. garam CaCl2 juga dapat mencegah reaksi pencoklatan non enzimatis yang disebabkan oleh efek khelasi (chelation) ion Ca terhadap asam-asam amino (Faust dan Klein. susu. renyah. terlalu mudah lumer V 34°C (94°F) Mengkilap. dan vanila (Rini. Selain dapat memperkuat tekstur.1. padat.1. mudah hancur. kakao. Kalsium juga mengubah proses–proses intraseluler dan ekstraseluler yang dapat memperlambat pemasakan buah. Menurut Kramer et al.Tabel 2. Karakteristik Sensori Lemak Kakao Kristal Suhu Leleh Efek Rasa I 17°C (63°F) Lunak. terlalu mudah lumer IV 28°C (82°F) Padat. Penggunaan cokelat jenis ini dikarenakan karakteristik dari milk chocolate compound yang tidak mudah meleleh pada suhu ruang sehingga sangat memudahkan dalam metode coating. terlalu mudah melumer III 26°C (78°F) Padat. terlalu mudah melumer II 21°C (70°F) Lunak. misalnya pada pembuatan manisan. patah kurang sempurna.4 CaCl2 Kalsium Khlorida (CaCl2) termasuk bahan pengeras atau firming agent untuk buah dan sayuran. mudah hancur.

juga mudah diperoleh.2. Diagram alir persiapan pembuatan manisan basah Kulit buah naga merah Pemotongan sisik Pengecilan ukuran Penimbangan kulit buah naga 200 g Air Larutan CaCl2 1% Pencucian Perendaman (t = 1.1.5 jam) Rendaman kulit buah naga Limbah . 2. CaCl2 eksogen selain harganya relatif murah.degradasi asam askorbat.1 Persiapan Pembuatan Manisan Basah Gambar 2. Perlakukan CaCl2 dengan pencelupan buah pasca panen tidak akan meninggalkan residu setelah buah dicuci dengan air (Pantastico.2 Proses Pembuatan Sweetdraco 2. 1993).

2 Pembuatan Manisan Basah Gambar 2.2. 1 menit) Perendaman larutan gula (t=24 jam) Manisan basah .2. Diagram alir pembuatan manisan basah Rendaman kulit buah naga Air Gula : asam sitrat : air 60% : 1% : 300 ml Perebusan (2 menit) Pencucian Limbah Penirisan Limbah Perebusan larutan gula (100 ˚C.2.

. Cup-cup tersebut lalu dikumpulkan dalam suatu toples plastik bening.3 Pembuatan Sweetdraco Gambar 2. Logo atau brand name serta informasi-informasi lainnya diterapkan pada label (label badan dan tutup tabung).2. Diagram alir pembuatan Sweetdraco Manisan basah Penirisan Pengeringan (60 ˚C. lalu dilapisi dengan kemasan cup kertas kecil. Sticker pada kemasan dibuat dengan tujuan agar tampilan visual secara keseluruhan dapat menarik. 10 jam) 200 g coklat + 10 g coating fat Manisan kering Pelapisan Pelelehan Tempering Sweetdragchol 2. Berikut ini merupakan desain kemasan produk grains roll cake. Plastik bening dipilih karena dapat menunjukkan keunikan bentuk manisan dan warnanya yang menarik.2. Manisan kering yang dihasilkan akan digulung.3 Kemasan Kemasan Sweetdraco menyerupai kemasan coklat praline.2.

Desain stiker Sweetdraco .Gambar 2.4.5. Konsep kemasan Sweetdraco Gambar 2.

2 Bahan Bahan yang digunakan dalam pembuatan Sweetdraco dalam satu resep adalah sebagai berikut. baskom.000/100 g ml 300 250/L gram 200 8. panci. Perendaman ini bertujuan untuk memperkuat tekstur manisan.000/100 g Air Coklat 3.1 Persiapan Pembuatan Manisan Basah Proses persiapan ini meliputi pembersihan sisik buah naga merah hingga menjadi kulit buah naga merah yang telah direndam dengan larutan CaCl2. METODOLOGI 3. talenan.1. wajan dan pengemas. Bahan Satuan Jumlah Harga (Rp) Kulit buah naga merah gram 200 5. sendok. oven listrik.000/100 g Asam sitrat gram 3 1.1 Alat dan Bahan 3.BAB 3. loyang.000/kg CaCl2 gram 2 10. neraca analitik.1 Alat Alat yang digunakan dalam pembuatan Sweetdraco adalah pisau.1.2 Proses Pembuatan Sweetdraco 3. Prosedur persiapan pembuatan manisan basah dapat dijelaskan dalam diagram alir berikut. .2. 3.000/kg Gula kristal putih gram 120 12.

5 jam) Rendaman kulit buah naga Limbah .Gambar 3. Diagram alir persiapan pembuatan Sweetdraco Kulit buah naga merah Pemotongan sisik Pengecilan ukuran Penimbangan kulit buah naga 200 g Air Larutan CaCl2 1% Pencucian Perendaman (t = 1.1.

Diagram alir pembuatan Sweetdraco Manisan basah Penirisan Pengeringan (60 ˚C.3. Diagram alir pembuatan manisan basah Rendaman kulit buah naga Air Gula : asam sitrat : air 60% : 1% : 300 ml Perebusan (2 menit) Pencucian Limbah Penirisan Limbah Perebusan larutan gula (100 ˚C.2 Pembuatan Manisan Basah Gambar 3.2.3 Pembuatan Sweetdraco Gambar 3. 1 menit) Perendaman larutan gula (t=24 jam) Manisan basah 3.2.3. 10 jam) 200 g coklat + 10 g coating fat Manisan kering Pelelehan Pelapisan Tempering Sweetdraco .2.

Preparasi Kulit Buah Naga Merah Air (200 ml) 200 g kulit buah naga merah  Pencucian Limbah (1%) Kulit buah naga merah yang sudah dibersihkan : Kadar air  Penirisan .60 1. CaCl2 0 0 0 0 100 4. Air 300 6. Analisis Mass Balance Komposisi Bahan Baku 1. CaCl2 2 4.3 0 10.7 0 53 0 28.3. Coklat 100 4. Asam sitrat 0 0 0 0 0 5. Mentah Air Kulit buah naga merah Protein Lemak Karbohidrat Mineral 62. Coklat 20 Tahapan Pra-Proses 1.71 0.1 Kebutuhan Bahan Baku Pembuatan Sweetdraco No. Kulit buah naga merah 200 2. Gula kristal putih 120 3.01 5. Gula kristal putih 3.3.05 0.5 0 0 94 0.5 2.9 0 3.63 35. Komposisi (%) Bahan Baku No. Air 6. Bahan Baku Kebutuhan Bahan (g) 1. Asam sitrat 3 5.

5 jam  Pencucian dan penirisan Limbah Diasumsikan tidak ada air yang keluar dari bahan akibat perendaman. sebab fungsi CaCl2 adalah memperkuat tekstur bahan.478 g – 5. 10 jam)  manisan kering Air 70% 70 kadar air menguap 70% = 100 ? 8.478 ? = 5.934 x 100% = 2.934 ? kadar air tertinggal = 8.066 x 100% = 3. Pembuatan Sweetdraco Manisan basah  Pengeringan (60˚C.06 94.934 g = 2. maka kadar air yang hilang hanyalah air yang menguap.934 x 100% = 3.544 g = 2. Air masuk = air keluar.Larutan CaCl2 1% Kulit buah naga  Perendaman 1.06 Kadar protein = 100 −5.544 100 −5. 2.25% . Ikatan kalsium dengan pektat membentuk kalsium pektat yang tidak larut dalam air.704% 3. Gula : asam sitrat : air 60% : 1% : 300 ml 60% Perebusan & perendaman Kulit buah naga   manisan basah Uap air 10% Kadar air perebusan = perendaman sebab air yang digunakan untuk merendam adalah air rebusan (tanpa penirisan).

066 x 100% = 73.55 x 100% = 0.66 69.066 18.31 94.066 Kadar mineral = 100 −5.66 Kadar lemak = 100 −5.934 x 100% = 18.0.934 x 100% = 69.68% x 100% =19.31 Kadar karbohidrat = 100 −5.934 x 100% = 0.70% 94.55 94.72% .

6 g Kadar protein = 0% = 100 ? 120 g = 0 g Kadar Lemak = 0% = 100 ? 120 g = 0 g Kadar Karbohidrat = 94% = 100 ? 120 g = 112.71% = Kadar Lemak = 0.5 Kadr air = 5.3% = 100 ? 20 ? = 0.8 g 0 0 94 0.1 ? ? 200 ? = 71.63% = Kadar Karbohidrat = 35.26 ? 35. 86 ? Kadar protein = 10.2 ? ? 200 ? = 2.71 100 0.7% = 10.5 Kadar Mineral (abu) = 0.05% = Kadar protein = 0.42 ? ? 200 ? = 1.6 g CaCl2 2 gram 100 Kadar Mineral (abu) = 100% = 100 ? 2 g = 2 g Asam Sitrat 3 gram Air 300 ml Kadar Air 100% = 300 ml Proses Pembuatan Sweetdraco Coklat 20 gram 4.01% = 62.5% = 100 ? 120 g = 0.05 100 0.4 ? .Tahapan Proses Utama (Pembuatan Manisan) Kulit Buah Naga Merah 200 gram : Kadr air = 62.7 100 ? 20 ? = 21.01 100 ? 200 ? = 124.5% = 100 ? 120 g = 6.60 100 1.63 100 ? 200 ? = 1.3 Kadr air = 4.02 ? Gula Kristal Putih 120 gram 5.60% = Kadar Mineral (abu) = 1.

97% Perendaman dengan CaCl2 2 gram dalam 300 ml air Larutan CaCl2 1% dalam 300 ml air Kulit buah naga 208 g  Perendaman 1.62 ? Preparasi Kulit Buah Naga Merah Air (200 ml) 200 g kulit buah naga merah   Pencucian Penirisan Limbah (1%) Kulit buah naga merah yang sudah dibersihkan : Berat air awal 62.1 208 ? 100 % = 64.47% ? 200 ? = 1.1 Kadar Mineral (abu) = 3.71 100 0.26 ? = 1.78 ? 28.23% 2.5 jam  Air 98% dan mineral 98% Pencucian dan penirisan .02 ? = ? 100% = 34.63 100 134 .42 ? 200 ? = 1.71% = Kadar Lemak = 0.42 ? = 1.1 ? 5 Berat air yang masuk dan setelah penerisan 5% = 100 ? 200 ? = 10 ? 1 Limbah yang terbuang 1% = 100 ? 200 ? = 2 ? Kadar air pada kulit buah naga = Kadar protein = 0.60 100 Kadar Mineral (abu) = 1.9% = 100 ? 20 ? = 5.60% = 35.2 208 ? 200 ? = 2.1% = 100 ? 20 ? = 0.2 ? = 71.01 100 208 208 ? 100% = 0.26 Kadar Karbohidrat = 35.9 3.6 ? Kadar Karbohidrat = 28.02 208 ? 100% = 0.01% = 1.05 100 ? 200 ? = 124.53 Kadar Lemak = 53% = 100 ? 20 ? = 10.05% = 62.68% ? 100% = 0.61% ? 200 ? = 71.63% = 0.

04 ? 100% = 32.71 100 0.95% Perebusan Gula : asam sitrat : air 120 g : 3 g : 300 g Kulit buah naga 216.1 Kadar air pada kulit buah naga = 216 .04? Jumlah berat mineral = 2.1 g 2 Berat air yang masuk dan setelah penerisan 2% = 100 ? 300 ? = 6? Jumlah berat air = 140.69 g .01 100 ? 200 ? = 2.1 ? = 13.58% ? 200 ? = 71.2 ? = 71 .42 ? = 216 . gula dan asam sitrat diserap bahan sebanyak 40% Kulit buah naga merah yang sudah direbus : Berat air pada kulit buah naga awal = 134.26 216 .26 ? = Kadar Karbohidrat = 35.85% Kadar protein = 0.42 ? 200 ? = 1.04 ? 100% = 0.66% ? 200 ? = 1.60 100 1.01% = 1.02 ? 2 Mineral yang terserap 1% = 100 ? 2 ? = 0.06 Kadar Mineral (abu) = 216 .1 g Berat Mineral (abu) = 1.04 ? 100% = 0.2 216 .04 ? 100 % = 64.71% = Kadar Lemak = 0.63% = 0.60% = 35.06 g 140 .63 100 1.41 ? Jumlah berat air total = 120.06 g Berat total = 216.04 ? 100% = 0.06  60% Perebusan & perendaman  manisan basah Air bahan menguap 10%.1 g 10 Berat air bahan yang menguap 10% = 100 ? 134.96% 2.Kulit buah naga merah yang sudah direndam : Berat air pada kulit buah naga = 134.

5 Bahan menyerap mineral = 0.26 ? = 1. Gula : asam sitrat : air 120 g : 3 g : 300 g Kulit buah naga 244.42 ? = 244 .63 g 120 .71 100 0.5% = 100 ? 48 ? = 0.69 g – 6.24 ? Jumlah berat mineral = 2.06 g + 0.63% = 0.2 g 40 Bahan menyerap asam sitrat sebanyak 40% = 100 ? 3 ? = 1.26 244 .63 ? 100 % = 49.2 g + 48 g = 119.69 g 5 Berat air bahan yang keluar 5% = 100 ? 120. gula dan asam sitrat diserap bahan sebanyak 10% Kulit buah naga merah yang sudah direndam : Berat air pada manisan basah = 120.3 g Jumlah berat total = 244.63 ? 100% = 0.84% Perendaman Perendaman dilakukan selama 12 jam.63 ? 100% = 0.63 ? 100% = 0.63  60% Perebusan & perendaman  manisan basah Air bahan keluar 5%.03 g = 114.63 ? 100% = 48.24 g = 2.58% ? 200 ? = 1.06 Kadar Mineral (abu) = 244 .03 ? Jumlah berat air total = 120.2 g + 48 g = 119.66 g Berat karbohidrat manisan basah = 71.52% 119 .63 100 1.69 ? = 6.40 Bahan menyerap gula sebanyak 40% = 100 ? 120 ? = 48? Jumlah berat karbohidrat = 71.73% 2.71% = Kadar Lemak = 0.2 Kadar Karbohidrat = 244 .34% Kadar protein = 0.42 ? 200 ? = 1.69 Kadar air pada kulit buah naga = 244 .2 g .2 ? 0.

35 g .57% Penirisan Kulit buah naga 363.63% = 0.2 g 2 Gula yang keluar dari bahan 2% = 100 ? 125.71 100 0. gula.89  Penirisan  manisan basah Air.41% Kadar Mineral (abu) = 2.7 g Berat asam sitrat awal = 1.26 ? = 1.42 ? 200 ? = 1.89 ? 100% = 0.66 g – 2.89 ? 100% = 0.34% 125 .71% = Kadar Lemak = 0.37 g Berat karbohidrat awal manisan basah = 125.51% Kadar protein = 0.2 g Bahan menyerap asam sitrat sebanyak 5% = 5 100 ? 3 ? = 0.2 g + 6 g = 125.2 g – 2.66 g 2 Berat air bahan yang keluar 2% = 100 ? 114.2 g + 0.39% ? 200 ? = 1.2 Kadar Karbohidrat = 363 .89 ? 100% = 0.42 ? = 363 .63 100 1.2 g Berat asam sitrat awal = 1.89 g 114 .89 ? 100% = 34.5 ? Jumlah berat karbohidrat = 125.06 363 .5 Gula yang terserap oleh bahan 5% = 100 ? 120 ? = 6 ? Jumlah berat karbohidrat = 119.15 ? Jumlah berat asam sitrat = 1.26 363 .15 g = 1.29 g = 112.89 ? 100 % = 31.2 ? = 2.35 g Jumlah berat total = 364.29 ? Jumlah berat air total = 114. dan asam sitrat yang tertiriskan sebesar 2 % Kulit buah naga merah yang sudah ditiriskan : Berat air awal pada manisan basah = 114.5 = 122.66 Kadar air pada kulit buah naga = 363 .66 ? = 2.

42 ? = 156 .83 g 33.26 ? = 1.11 ? 100 % = 46.83 1.91% ? 200 ? = 1.83 ? 100% = 0.3 g Jumlah berat total = 241.3 g Jumlah berat total = 156.26 ? = ? 100% = 78.63% = 0.71 g Berat karbohidrat = 122.11g 112 .11 ? 100% = 0.42 ? 200 ? = 1.7 g Berat asam sitrat awal = 1.027 g = 1.06 241 .85% Pembuatan Sweetdraco Pengovenan Manisan basah Pengeringan (60˚C.0.37 g 70 Berat air bahan yang menguap 70% = 100 ? 1 ? = 78.35 = 0.61% Kadar protein = 0.71 Kadar air pada kulit buah naga = 156 . 10-12 jam)  manisan kering Air 70% Kulit buah naga merah yang sudah dioven : Berat air awal pada manisan basah = 112.11 ? 100% = 0.7 Kadar Karbohidrat = 241 .83 ? 100% = 0.11 ? 100% = 0.63 100 1.26 241 .59% ? 200 ? = 1.7 156 .63 100 122 .8% .24% 1.42 ? = 241 .52% 122 .027 ? Jumlah berat asam sitrat = 1.83 ? 100 % = 21.37 g – 78.11 ? 100% = 50.71% = Kadar Lemak = 0.42 ? 200 ? = 1.37 Kadar air pada kulit buah naga = 241 .71% = Kadar Lemak = 0.35 g .63% = Kadar Karbohidrat = 0.89% Kadar Mineral (abu) = 2.66 ? Jumlah berat air total = 112.71 100 0.50% Kadar protein = 0.2 Berat asam sitart yang keluar 2% = 100 ? 1.26 156 .66 g = 33.71 100 0.

01% Kadar lemak = (1.83 g) x 100% = 2.83 g Kadar air = (33.2.7 g + 5.83 g) x 100% = 6.83 g) x 100% = 19.71% Kadar karbohidrat = (122.83 ? 100% = 1.83 g = (34.83 g) x 100% = 72.48 g / 176.86 g / 176.62 g) / 176.71 g + 0.14 g) / 176.52% .83 g = (2.57 g / 176.06 Kadar Mineral (abu) = 156 .55% Kadar protein = (1.42 g + 2.78 g) / 176.83 g = (11.26 g + 10.56 g / 176.83 g = (3.06 g + 0.6 g) / 176.83 g) x 100% = 1.83 g = (128.68 g / 176.66% Kadar mineral (abu) = (2.86 g) / 176.31% Mass Balance Produk Akhir Total bahan = manisan kulit buah naga kering + coklat =683 g + 20 g = 176.

2 30 2 300 5 16 100 Pack /Hari 2. 6. MENETAPKAN ASUMSI Menetapkan asumsi pada perencanaan industri dilakukan untuk mempermudah pemetaan gambaran dan konsep industri yang akan dibangun. Permodalan (modal) dibagi menjadi beberapa aspek yaitu modal tetap (investasi) dan modal operasional.Coklat (batang) Jumlah Hari Kerja Periode Proyek Discount Rate Permodalan Sendiri 5. BIAYA INVESTASI Pada perhitungan biaya (modal) digunakan untuk mengetahui modal atau dana yang dibutuhkan dalam mendirikan industri. 1.ANALISIS FINANSIAL INDUSTRI SWEETDRACO (sweet dragon fruit skin with chocolate) Analisis finansial yaitu melihat pada suatu proyek dari sudut pandang lembaga atau badan yang mempunyai kepentingan langsung dalam proyek dan yang menginvestasi modalnya pada proyek.CaCl2 . 3. Pada menetapkan asumsi pada industri Sweetdraco adalah sebagai berikut :  Agroindustri: Sweetdraco (sweet dragon fruit skin with chocolate) No. 8. 7. Uraian Satuan Jumlah 1. % 400 pack (@9 sweetdraco) 60 Kg/Hari Kg/Hari Kg/Hari Kg/Hari L/Hari Kg/Hari Hari/Tahun Tahun % % 20 12 0.Asam sitrat . .Kulit buah naga . Rendemen Kebutuhan Bahan Baku . Bertujuan untuk mengetahui kegiatan proyek (kegiatan usaha) yang akan dilakukan menguntungkan secara finansial.3 0.Gula kristal putih . Kapasitas Produksi 2.Air .

000 30.000 200.000 5.775. Perijinan  PIRT dan NPWP (1 tahun) Jumlah Satuan Paket Unit Paket Jumlah (Rupiah) 4.000 600.000 750.000 120.000 75.000 500.000 Jumlah Investasi (Rp.200.000 150.000 5.000 100.) 5.000 75.500.000 1. kapasitas 120 pack/hari (@10 sweetdraco) Nama Alat Jumlah Harga (Unit) (Rp.000 500.000 300.000.000.000 2. Uraian 1.Berikut adalah penjelasan dari perhitungan biaya atau modal yang diperlukan dalam pembangunan industri sweetdraco adalah sebagai berikut.000 1.000  BIAYA INVESTASI (MESIN DAN PERALATAN)  Pembuatan Sweetdraco.000 5.000.000.000 750.000 4.000 7.000 25.000 860. Sewa rumah 2.000 3.000 200.000 50.000 2.030./Unit) Pisau Pemotong 5 Timbangan 2 Telenan 5 Pompa air 1 Drum Penampung 4 Oven 2 tangki air 1 kompor 3 tabung gas 4 pengaduk stainles 5 Kulkas 1 Total 5.000. Sepeda Motor (2) 3.000 5.000 250.000 1.000 Paket 30.) 25.000 25.000.000 150. Peralatan Kantor 4.000 120.000 .000 11.000 Umur Ekonomis (Tahun) 5 5 5 10 10 10 10 5 10 5 10 Penyusutan (Rp.000 750.  BIAYA INVESTASI TOTAL No.

Pajak yang dikeluarkan tiap tahun per unit penjualan = pajak per unit x penjualan per tahun = 11.3.400.       2.000 25.000 600.000 b.000 860.000 c.96.000 = Rp. 4.600. 3.520.000 72. maka industri akan rugi dan apabila harga gula .000.000 27./Tahun) 860.250.000. Apabila harga gula relatif rendah dibandingkan pesaing. Harga yang ditawarkan sweetdraco yang ditawarkan harus dapat bersaing dengan sweetdraco yang diproduksi oleh industri yang lain.000 Kg 3.000 1. Uraian 1.800 Tahun 11. Biaya Variabel No. Uraian Kulit buah naga Gula kristal putih Asam sitrat CaCl2 Air Cokelat batang Listrik Kemasan BBM (6) Pajak Karyawan (6 orang) Satuan Volume Bahan Baku Kg 6.000 2.000.5% Rp.000 11. 1.000.5% x 840. 5.000 3.000 L 1. BIAYA PRODUKSI (Per Tahun) a.000 11.000.000.000 Jumlah 538.000 Total Cost (Rp. 6. proyeksi permintaan dan analisis pesaing. 72 Harga (Rp) Total Cost (Rp. Peyusutan Jumlah Satuan Jumlah Rp 1 Harga 1.000 250 45.400 12. Biaya Tetap No.000 96.000 9.000.290.500 10.000 Kg 600 Rp/ Kwh 120 unit 120.170.000 41.000 6.000 4.000 3.000 360. HARGA POKOK PRODUKSI Pada industri sweetdraco dalam menentukan harga jual produk menggunakan sistem analisis biaya.000.600.000 100.600 Kg 60 Kg 90 L 9./Tahun) 2.

91 = Rp.170. 1. maka gula tidak akan laku dan akan berakibat kerugian pada industri yang didirikan.801.000 HPP = Rp.5 7.000 120.500 + 1. 3.4.000 538.030.575 Harga jual (Rp) = 4.5 = Rp.575 = 6.100 Harga x pajak = Rp.Margin Keuntungan = 35% 35% x Rp. 4. Berikut ini madalah penentapan harga pokok produksi (HPP) dan harga jual pada industri sweetdraco: No. 4.500 = Rp.100 6.000 120. 5.000 Rumus Penentuan Harga Pokok Produksi (HPP) HPP = HPP = Jumlah (Rp) 538. 8.000+860. HPP digunakan sebagai dasar untuk menetapkan harga suatu produk. 6.801.170.500.7.075 = 6.500 35% Rp/Pack Rp/Pack 6.030. 4.000 539.600 860. dimana harga yang ditetapkan dapat menutup seluruh biaya produksi pada tingkat produksi tertentu.000 120.relatif tinggi dibandingkan dengan pesaing.491. 2. 1.115 = 6.000 539. Uraian Biaya Variabel Biaya Tetap Total Biaya Volume Produksi Harga Pokok Produksi (HPP) Margin Keuntungan Harga Jual x pajak Harga Final Satuan Rp/Tahun Rp/Tahun Rp/Tahun Pack/Tahun Rp/Pack 4. Harga pokok produksi (HPP) adalah harga pokok penjualan suatu produk yang merupakan total biaya untuk memproduksi satu unit produk. 6.000 .100 x 1. 7.

000 7.000 7.000 7.000 840 Juta Tahun 3 120.000 840 Juta Tahun 4 120.000 840 Juta Tahun 5 120.000 Harga Rp/pack 7.000 7.000 Penjualan Rp/tahun 840 Juta Tahun 2 120.000 840 Juta .PROYEKSI PENDAPATAN Uraian Satuan Tahun 1 Produksi pack/tahun 120.

3 Biaya variabel 1.000.0000 11.000.000.000 12.0000 72.000.000 360.250.000 2.030.000 538.000 41.000.000 27.000 12.520.0000 11.250.000.000 9.000 12.000.000 2.000 2.000 860.000 41.000 12.000. Bahan Kulit Buah Naga Gula krital putih Asam sitrat Cacl2 Air Coklat batang Kemasan Bbm Pajak Listrik Karyawan .250.0000 11.000 538.0000 72. Parameter 1.000 27.MEMBUAT ARUS KAS (CASH FLOW) No.1 Investasi 11.000.       2.000 538.000.000 360.400.000 41.0000 11.470.000.000 600.000 538.520.0000 72. 6.000 12.000 600.000 3.000 27. 5.000 860.000.000.000 860.000 27.000 43.000 538. Penjualan Tahun 0 Tahun 1 840 Juta Tahun 2 840 Juta Tahun 3 840 Juta Tahun 4 840 Juta Tahun 5 840 Juta 2.0000 11.000.000.400.170.170.000 41.000 43.520.000 3.000 2.000 860.000.000 600.000 360.000 3.000 41.2 Biaya tetap 860.250.000 43. Pembiayaan 2.000 43.0000 72.000.000 9.000.400.000 860.000 9.000 2.000.520.000 860.470.000 2.000.470.520.000.000.000 9.000.000.0000 72.400.470.170.000. 4.000.000.000.000.000 600.000 3.000 360.000 43.170.000 860.000 27.000 3.470. 3.000 360.250.000 600.000  Penyusutan 860.000 9.000.400.000 860.170.000 2.

170.000 = Rp.000−4. BEP  Variabel Per Unit = ????? ???????? ??? ?? ℎ?? ?????? ???????? ??? ?? ℎ?? = 538.485) = 341.000 = (7.948 = 342 Unit  BEP Rupiah = BEP Unit X Harga Final = 342 unit X 7.000. BEP Unit ? = (?−? ????) 860.485.- . 2.394. 4.000 120.000 = Rp.5.

R. Compositional Data. 1997. K. Prince of Songkla University. Williams. S.. pp. M. Wahem. B.X. CRC Press. Jakarta: Kawan Pustaka. Anklam. Linsley. Faust. N. F.. Levels and Sites of Metabolically active Ca in Apple Fruit.Soc.. dan Arpi. 357-366. Klein. Mixture of Plam Kernel Oil with Cocoa Butter and Milk Fat in Compound Coating. 2012. D. M. Winarno. J. dan E. 1994. E. Bioscience 2010 Conferences . 1991. D..DAFTAR PUSTAKA Bizri. Wang dan W. F. U. (2010). Yogyakarta: Kanisius. I. E. Vol.G. G. Boca Raton Florida Indarti. Journal of Food Chemistry. Fisiologi Pasca Panen. Susanto. 1993. R. 73-97.W. Y. Kreasi Olahan Coklat. K. Teknik Sumber Daya Air. Franzini.L. Review of Cocoa Butter and Alternative Fats for Use in Chocolate-Part A. dan J. Penerjemah: Djoko Sasongko.L. 1989.the 7th IMT-GT UNINET and the 3rd Joint International PSU-UNS. Amer. J. 1973. Improved Stability Characteristics of Aceh Cacao Butter by Tempering Process. Tanaman Kakao.Hoc. Hartel.Sci. Yogyakarta: Gadjah Mada University Press. No. Penanganan dan Pemanfaatan Buah-buahan dan Sayuran Tripika da Sub Tropika. of Food Science 59 (1) : 130-134. Jakarta: Gramedia Pustaka Utama. 74. Pantastico. Conway. Ransom and R. dan A.. Lipp. Citric Acid and Antimicrobials Affect Microbiological Stability and Quality of Tomato Juice. F. Jakarta: Erlangga. 1997. and J. N. S. Rini. 1998. 1994. C. Kramer. Kimia Pangan dan Gizi. J. 62. Journal of American Oil Chemists Society. Correlation of Reduced Softening and Increaced Polyamin Levels. .