Anda di halaman 1dari 51

LAPORAN RESMI

PRAKTIKUM DASAR TEKNIK KIMIA I

Materi:
ACIDI ALKALIMETRI

Oleh:
Nama

: Brigitta Bella Timang Putri

NIM

: 21030113120015

Kelompok

: 2 Rabu Pagi

LABORATORIUM DASAR TEKNIK KIMIA


JURUSAN TEKNIK KIMIA FAKULTAS TEKNIK
UNIVERSITAS DIPONEGORO
SEMARANG
2013

LAPORAN RESMI
PRAKTIKUM DASAR TEKNIK KIMIA I

Materi:
ACIDI ALKALIMETRI

Oleh:
Nama

: Brigitta Bella Timang Putri

NIM

: 21030113120015

Kelompok

: 2 Rabu Pagi

LABORATORIUM DASAR TEKNIK KIMIA


JURUSAN TEKNIK KIMIA FAKULTAS TEKNIK
UNIVERSITAS DIPONEGORO
SEMARANG
2013

ACIDI ALKALIMETRI
HALAMAN PENGESAHAN

Materi

: Acidi Alkalimetri

Kelompok

: 2 Rabu Pagi

Anggota

1. Brigitta Bella Timang Putri

21030113120015

2. Muhamad Ihsan Maulana

21030113120007

3. Mukhammad Mujahid Almakhi

21030113120077

Telah disetujui dan disahkan oleh Asisten Pembimbing pada:


Hari

: Minggu

Tanggal

: 15 Desember 2013

Semarang, 15 Desember 2013


Asisten Pembimbing

Dani Puji Utomo


NIM. 21030112130131

Laboratorium Dasar Teknik Kimia 1

ii

ACIDI ALKALIMETRI
PRAKATA

Puji syukur ke hadirat Tuhan Yang Maha Esa yang telah melimpahkan
berkat dan rahmat-Nya sehingga Laporan Resmi Praktikum Dasar Teknik Kimia I
dapat terselesaikan.
Penyusunan laporan ini ditujukan sebagai salah satu syarat untuk
melengkapi mata kuliah Praktikum Dasar Teknik Kimia I sekaligus mempelajari
materi Acidi Alkalimetri yang telah diberikan di bangku kuliah.
Ucapan terima kasih kepada:
1. Dr.Widayat, ST, MT selaku dosen penanggung jawab Laboratorium Dasar Teknik
Kimia I Jurusan Teknik Kimia Fakultas Teknik Universitas Diponegoro;
2. Dani Puji Utomo selaku asisten pembimbing laporan resmi praktikum Acidi
Alkalimetri dan semua asisten yang telah membimbing selama praktikum
sehingga laporan resmi ini dapat terselesaikan;
3. Semua pihak yang telah membantu tersusunnya laporan ini.
Laporan resmi ini masih terdapat kekurangan, oleh karena itu diharapkan
kritik dan saran yang membangun demi penyempurnaan laporan resmi ini. Semoga
Laporan Resmi Praktikum Dasar Teknik Kimia I materi Acidi Alkalimetri ini
bermanfaat bagi semua pihak.

Semarang, 15 Desember 2013

Penyusun

Laboratorium Dasar Teknik Kimia 1

iii

ACIDI ALKALIMETRI
DAFTAR ISI

HALAMAN PENGESAHAN ..............................................................................

ii

PRAKATA ...........................................................................................................

iii

DAFTAR ISI ........................................................................................................

iv

DAFTAR TABEL .................................................................................................

DAFTAR GAMBAR ...........................................................................................

vi

INTISARI .............................................................................................................

vii

SUMMARY .........................................................................................................

viii

BAB I PENDAHULUAN
I.1 LATAR BELAKANG ...........................................................................

I.2 TUJUAN PERCOBAAN ......................................................................

I.3 MANFAAT PERCOBAAN ..................................................................

BAB II TINJAUAN PUSTAKA ..........................................................................

BAB III METODE PERCOBAAN


III.1 BAHAN DAN ALAT YANG DIGUNAKAN ...................................

10

III.2 GAMBAR ALAT ...............................................................................

10

III.3 KETERANGAN ALAT .....................................................................

11

III.4 CARA KERJA ....................................................................................

12

BAB IV HASIL PERCOBAAN DAN PEMBAHASAN


IV.1 HASIL PERCOBAAN .......................................................................

14

IV.2 PEMBAHASAN ................................................................................

15

BAB V PENUTUP
V.1 KESIMPULAN ....................................................................................

19

V.2 SARAN ................................................................................................

19

DAFTAR PUSTAKA ..........................................................................................

20

LAMPIRAN
A. LEMBAR PERHITUNGAN REAGEN ............................................... A-1
B. LEMBAR PERHITUNGAN ................................................................ B-1
C. LEMBAR PERHITUNGAN GRAFIK ................................................ C-1
D. LAPORAN SEMENTARA .................................................................. D-1
E. LEMBAR KUANTITAS REAGEN ....................................................

E-1

F. REFERENSI .........................................................................................

F-1

Laboratorium Dasar Teknik Kimia 1

iv

ACIDI ALKALIMETRI
DAFTAR TABEL

Tabel 2.1 Identifikasi Campuran Bikarbonat .......................................................

Tabel 4.1 Kadar Na2CO3 pada Sampel I dan II ....................................................

14

Tabel 4.2 Kadar NaHCO3 pada Sampel I dan II ..................................................

14

Tabel 4.3 Kadar Asam Asetat dalam Cuka ..........................................................

14

Tabel 4.4 Kadar Asam Sitrat dalam Citrun Zuur .................................................

14

Tabel 4.5 Kadar Asam Askorbat dalam Jeruk Nipis .............................................

14

Laboratorium Dasar Teknik Kimia 1

ACIDI ALKALIMETRI
DAFTAR GAMBAR

Gambar 2.1 Ascorbic Acid Oxidation ..................................................................

Gambar 3.1 (1) Statif (2) Klem (3) Buret (4) Erlenmeyer ...................................

10

Gambar 3.2 Corong ..............................................................................................

10

Gambar 3.3 Pipet volume .....................................................................................

10

Gambar 3.4 Pipet ukur .........................................................................................

11

Gambar 3.5 Pengaduk ..........................................................................................

11

Gambar 3.6 Beaker glass ......................................................................................

11

Gambar 3.7 Pipet tetes .........................................................................................

11

Gambar 3.8 Labu takar .........................................................................................

11

Gambar 3.9 Gelas ukur ........................................................................................

11

Gambar 4.1 Grafik Hubungan Volume HCl vs pH Sampel 1 ..............................

16

Gambar 4.2 Grafik Hubungan Volume HCl vs pH Sampel 2 ..............................

16

Laboratorium Dasar Teknik Kimia 1

vi

ACIDI ALKALIMETRI
Intisari

Asam basa merupakan parameter lingkungan yang vital dalam kehidupan


sehari-hari. Analisis mengenai kandungan atau konsentrasi asam basa dapat
ditentukan dengan titrasi cross check. Titrasi asam basa ini disebut acidi alkalimetri.
Tujuan percobaan ini adalah menganalisa kadar/konsentrasi asam atau basa suatu
sampel.
Titrasi adalah penentuan kadar suatu zat secara volumetri menggunakan
larutan lain yang telah diketahui kadarnya. Dasar acidi alkalimetri adalah reaksi
penetralan antara titran dengan zat yang akan dititrasi. Acidimetri adalah
penentuan kadar basa dalam suatu larutan menggunakan larutan asam yang telah
diketahui konsentrasinya sebagai titran. Alkalimetri adalah penentuan kadar asam
dalam suatu larutan menggunakan larutan basa yang telah diketahui konsentrasinya
sebagai tiran.
Dalam percobaan ini dilakukan standarisasi HCl dengan boraks 0,1 N,
standarisasi NaOH dengan HCl yang telah distandarisasi, menentukan kadar
Na2CO3 dan NaHCO3 dalam sampel I dan II, menentukan kadar asam asetat dalam
cuka, asam sitrat dalam citrun zuur, dan asam askorbat dalam jeruk nipis.
Hasil percobaan adalah kadar praktis Na2CO3 dalam sampel I dan II
sebesar 12.629,40 ppm dan 13.393,17 ppm. Kadar teoritis Na2CO3 dalam sampel I
dan II sebesar 15.000 ppm dan 16.250 ppm. Kadar praktis NaHCO3 dalam sampel I
dan II sebesar 9.959,57 ppm dan 10.597,24 ppm. Kadar teoritis NaHCO3 dalam
sampel I dan II sebesar 12.000 ppm dan 13.000 ppm. Kadar yang ditemukan lebih
kecil disebabkan oleh kristal NaOH bersifat higroskopis dan konsentrasi HCl yang
mudah berubah mempengaruhi TAT 1 dan TAT 2. Asam sitrun merupakan zat kimia
yang digunakan untuk memberi rasa asam pada makanan dan minuman. Dari hasil
percobaan, kadar asam sitrat yang terdapat dalam citrun zuur adalah 8,918%. Pada
dasarnya, cuka adalah larutan asam asetat dalam air. Kadar asam asetat dalam
cuka yang diperoleh adalah 18,102%. Asam askorbat adalah nama lain dari vitamin
C. Dalam percobaan, kadar asam askorbat dalam jeruk nipis adalah 14,678%.
Kadar Na2CO3 dalam sampel I dan II sebesar 12.629,40 ppm dan 13.393,17
ppm. Kadar NaHCO3 dalam sampel I dan II sebesar 9.959,57 ppm dan 10.597,24
ppm. Kadar asam sitrat yang terdapat dalam citrun zuur adalah 8,918%. Kadar
asam asetat dalam cuka adalah 18,102%. Kadar asam askorbat dalamjeruk nipis
adalah 14,678%. Kadar Na2CO3 dan NaHCO3 yang diperoleh lebih kecil
dibandingkan kadar teoritisnya disebabkan oleh kristal NaOH bersifat higroskopis
dan konsentrasi HCl yang mudah berubah mempengaruhi TAT 1 dan TAT 2. Sebagai
saran, memastikan semua alat yang akan digunakan dalam keadaan bersih, mencuci
buret setiap pergantian titran, mencuci erlenmeyer setiap pergantian larutan,
mengukur volume dengan pipet volume untuk mendapatkan hasil yang akurat, dan
segera melarutkan kristal NaOH setelah penimbangan untuk meminimalkan reaksi
dengan CO2 di udara.

Summary

Laboratorium Dasar Teknik Kimia 1

vii

ACIDI ALKALIMETRI

Acid-base is the vital parameters of the environment in daily life. Analysis of


the content or the concentration of acid-base can be determined with a cross check
titration. Acid-base titration is called acidic alkalimetry. The purpose of this
experiment is to analyze the level/concentration of acid or alkaline in a sample.
Titration is the determination of substances concentration using other
known concentration of solution in volumetric. The basic of acidic alkalimetry is
neutralization reaction between the titrant with the substance that will be titrated.
Acidimetric is the determination of base concentration in a solution using known
concentration of acid solution as a titrant. Alkalimetry is the determination of acid
concentration in a solution using known concentration of alkaline solution as a
titrant.
In this experiment, things that should be done is HCl standardization with
0.1N of borax, NaOH standardization with standardized HCl, determination of
concentration of Na2CO3 and NaHCO3 in the sample I and II, determination of
acetic acids concentration in vinegar, citric acid in citrun zuur, and ascorbic acid in
citrus lime.
The result of the experiment is practical concentration of Na2CO3 in the
sample I and II are 12,629.40 ppm and 13,393.17 ppm. Theoretical concentration of
Na2CO3 in the sample I and II are 15,000 ppm and 16,250 ppm. Practical
concentration of NaHCO3 in the sample I and II are 9,959.57 ppm and 10,597.24
ppm. Theoretical concentration of NaHCO3 in the sample I and II are 12,000 ppm
and 13,000 ppm. The practical concentration that was found smaller than the
theoretical is caused by hygroscopic characteristic of NaOH crystals and easily
changes concentration of HCl, so it affects the first equivalence point and the second
equivalence point. Citric acid is a chemical substance that used to give sour taste to
foods and beverages. From the experimental results, concentration of citric acid in
citrun zuur is 8.918 %. Basically, vinegar is a solution of acetic acid in water. The
concentration of acetic acid in vinegar is 18.102 %. Ascorbic acid is another name
for vitamin C. From the experiments, the concentration of ascorbic acid in lime is
14.678%.
Concentration of Na2CO3 in the sample I and II are 12,629.40 ppm and
13,393.17 ppm. Concentration of NaHCO3 in the sample I and II are 9,959.57 ppm
and 10,597.24 ppm. Concentration of citric acid in the citrun zuur is 8.918%.
Concentration of acetic acid in the vinegar is 18.102%. Ascorbic acids
concentration in the lime is 14.678%. Concentration of Na2CO3 and NaHCO3 is
smaller than the theoretical concentration is caused by hygroscopic characteristic of
NaOH crystals and easily changes concentration of HCl, so it affects the first
equivalence point and the second equivalence point. As suggestions, make sure all of
the tools that will be used is clean, wash the burette every changing of the titrant,
wash erlenmeyer every changing of the solution, measure the volume with volume
pipette to obtain accurate results, and dissolve NaOH crystals immediately after
weighing to minimize the reaction with CO2 in the air.

Laboratorium Dasar Teknik Kimia 1

viii

ACIDI ALKALIMETRI
BAB I
PENDAHULUAN

I.1 Latar Belakang Masalah


Asam basa merupakan parameter lingkungan yang sangat vital dalam
kehidupan sehari-hari kita. Air, tanah, limbah, maupun zat makanan seperti buah dan
sayur dapat mengandung zat asam maupun basa. Zat-zat tersebut dapat dinyatakan
dalam derajat keasaman (pH) atau derajat kebasaannya (pOH). Analisis mengenai
kandungan atau yang lazim disebut konsentrasi asam maupun basa dalam kimia
analisa dapat dilakukan dengan titrasi secara cross check. Zat asam dapat diketahui
kadarnya dengan menggunakan zat basa sebagai titrannya maupun sebaliknya zat
basa dapat dinilai menggunakan zat asam sebagai titran. Hal ini dapat dipelajari
dalam materi acidi-alkalimetri atau kesetimbangan asam basa.
I.2 Tujuan Percobaan
a. Menganalisa kadar/konsentrasi suatu sampel (% berat, % volume, % R/V, %
M, %N).
b. Menganalisa kadar aciditas, alkalinity dari suatu sampel.
I.3 Manfaat Percobaan
Mengetahui adanya kadar/konsentrasi (% berat, % volume, % R/V, % M, % N) suatu
zat dalam sampel.

Laboratorium Dasar Teknik Kimia 1

ACIDI ALKALIMETRI
BAB II
TINJAUAN PUSTAKA

II.1 Pengertian
Titrasi adalah penentuan kadar suatu zat secara volumetrik menggunakan
larutan lain yang telah diketahui kadarnya. Reaksi yang terjadi antara asam dan basa:
H+ + OH H2O
Acidi alkalimetri merupakan salah satu bentuk titrasi berdasarkan reaksi
netralisasi antara zat titran dan zat yang akan dititrasi.
Acidimetri: penentuan kadar basa dalam sutau larutan dengan menggunakan larutan
asam yang telah diketahui konsentrasinya sebagai titran.
Natrium hidroksida lazim tercemar dengan natrium karbonat. Hal ini
disebabkan NaOH dapat menyerap CO2 yang terdapat dalam udara dan bereaksi
sebagai berikut:
CO2 + 2 OH CO3 + H2O
Seringkali natrium karbonat dan natrium bikarbonat terdapat bersama-sama.
Dimungkinkan untuk menganalisis campuran senyawa ini dengan titrasi dengan
asam standart.
II.2 Titrasi Karbonat
Ion karbonat dititrasi dengan asam kuat sebagai titran, reaksi yang terjadi:
CO3 2- + H3O+

HCO3 + H2O ............. (1)

HCO3 + H3O+

H2CO3 + H2O ............ (2)

Ka1 = 4,6.107
Ka2 = 4,4.1011

pKa = 6,34
pKa = 10,36

PP digunakan sebagai indikator untuk reaksi pertama (TAT pertama) dan


MO digunakan sebagai indikator pada reaksi yang kedua (TAT kedua).
II.3 Hubungan Volume dalam Titrasi Karbonat
Dalam suatu larutan zat NaOH, Na2CO3, maupun NaHCO3 keberadaannya
dapat sebagai zat tunggal. Namun sering kali terdapat bersama-sama misalnya,
NaOH tercampur dengan Na2CO3 atau NaHCO3 dan Na2CO3 terdapat bersama-sama.
Hal ini dapat teridentifikasi setelah senyawa tersebut dititrasi dengan HCl.

Laboratorium Dasar Teknik Kimia 1

ACIDI ALKALIMETRI
Tabel 2.1 Identifikasi Campuran Bikarbonat
Zat

Hubungan u/ identifikasi kualitatif

NaOH

y=0

Na2CO3

x=y

NaHCO3

x=0

NaOH + Na2CO3

x>y

NaHCO3 + Na2CO3

x<y

Milimol zat yg ada

Keterangan :
M = molaritas
x = volume yang dibutuhkan untuk mencapai TAT I menggunakan indikator PP
y = volume yang dibutuhkan untuk mencapai TAT II menggunakan indikator MO

Diagram titrasi Na2CO3 dan NaHCO3


Na2CO3 .. PP ditambahkan x ml
x ml

HCl
NaHCO3 .. PP berubah warna, MO ditambahkan

x ml
y ml

HCl
NaCl

NaHCO3

y-x ml

HCl
NaCl ... MO berubah warna

Keterangan
: dititrasi
: jumlah volume titran
Alkalimetri : penentuan kadar asam dalam suatu larutan dengan menggunakan
larutan basa yang telah diketahui konsentrasinya sebagai titran.
Asam asetat, asam etanoat atau asam cuka adalah senyawa kimia asam
organik yang dikenal sebagai pemberi rasa asam dan aroma dalam makanan. Atom
hidrogen (H) pada gugus karboksil (COOH) dalam asam karboksilat seperti dalam
asam asetat dapat dilepaskan sebagai ion H+ (proton), sehingga memberikan sifat
asam. Asam asetat adalah asam lemah monoprotik dengan nilai pKa=4,8. Basa

Laboratorium Dasar Teknik Kimia 1

ACIDI ALKALIMETRI
konjugasinya adalah asetat (CH3COO). Sebuah larutan 1,0 M asam asetat (kira-kira
sama dengan konsentrasi pada cuka rumah) memiliki pH sekitar 2,4. (wapedia)
Vitamin C merupakan nama lain dari ascorbic acid yang tidak lain adalah
sejenis asam. Vitamin C larut dalam air dan dapat ditemukan buah jeruk, tomat, dan
sayuran hijau dengan konsentrasi tinggi. Vitamin C merupakan vitamin yang tidak
stabil karena mudah teroksidasi dan dapat hilang selama proses memasak. Peran
utama vitamin C dalam tubuh adalah sebagai penghasil kolagen, sejenis protein
penting dalam jaringan alat gerak. Vitamin C juga berperan penting dalam sintesa
hemoglobin dan metabolisme asam amino. Selain itu, vitamin C juga mampu
menangkal nitrit penyebab kanker. Hipoaskorbemia (defisiensi asam askorbat) bisa
berakibat seriawan, baik di mulut maupun perut, kulit kasar, gusi tidak sehat
sehingga gigi mudah goyah dan lepas, perdarahan di bawah kulit (sekitar mata dan
gusi), cepat lelah, otot lemah dan depresi.

Gambar 2.1 Ascorbic Acid Oxidation


Jeruk nipis (Citrus aurantifolia Swingle) merupakan buah yang
mengandung banyak air dan vitamin C yang cukup tinggi. Daun, buah, dan bunganya
mengandung minyak terbang. Jeruk nipis mengandung asam sitrat, asam amino
(triptofan, lisin), minyak atsiri (sitral, limonen, felandren, lemon kamfer, kadinen,
gerani-lasetat, linali-lasetat, aktilaldehid, nildehid) damar, glikosida, asam sitrun,
lemak, kalsium, fosfor, besi, belerang, vitamin B1 dan C.
Dari kandungan berbagai minyak dan zat di dalamnya, jeruk nipis
dimanfaatkan untuk mengatasi disentri, sembelit, ambeien, haid tak teratur, difteri,
jerawat, kepala pusing atau vertigo, suara serak, batuk, bau badan, menambah nafsu
makan, mencegah rambut rontok, ketombe, flu, demam, terlalu gemuk, amandel,
penyakit anyang-anyangan (kencing terasa sakit), mimisan, dan radang hidung.
Dari beberapa penelitian terakhir menunjukkan, jeruk nipis juga mempunyai
manfaat mencegah kekambuhan batu ginjal, khususnya batu ginjal kalsium idiopatik.

Laboratorium Dasar Teknik Kimia 1

ACIDI ALKALIMETRI
Menurut laporan tersebut, mengkonsumsi jeruk nipis bisa mencegah timbulnya batu
ginjal.
Pada suatu penelitian diketahui bahwa jeruk nipis mengandung sitrat yang
tinggi. Dinyatakan bahwa kandungan sitrat jeruk nipis lokal (Citrus aurantifolia
Swingle yang bulat) 10 kali lebih besar dibanding kandungan sitrat pada jeruk
keprok, atau enam kali jeruk manis. Kandungan sitratnya mencapai 55,6 gram per
kilogram.
II.4 Indikator
Indikator merupakan suatu zat yang digunakan untuk menentukan kapan
titik akhir titrasi (TAT) tercapai dengan indikasi perubahan warna.
Pada saat TAT tercapai maka jumlah mol equivalen zat dititrasi sama
dengan jumlah mol equivalen zat titran.
Indikator yang akan digunakan dalam titrasi acidi alkalimetri adalah :
a. PP (phenolphthalein)
Asam diprotik tidak berwarna, dengan trayek pH 8-9,6.
b. MO (Methyl Orange)
Suatu basa berwarna kuning dalam bentuk molekulnya, dengan trayek pH
3,1-4,4.
II.5 Kurva Titrasi
Titrasi asam basa dapat dinyatakan dalam bentuk kurva titrasi antara pH
(pOH) versus mililiter titran. Kurva semacam ini membantu mempertimbangkan
kelayakan suatu titrasi dalam memilih indikator yang tepat. Akan diperiksa dua kasus,
titrasi asam kuat dengan basa kuat dan titrasi asam lemah dengan basa kuat.
a. Titrasi Asam Kuat dan Basa kuat
Asam kuat dan basa kuat terhidrolisa dengan lengkap dalam larutan air. Jadi
pH sama di berbagai titik selama titrasi. Dapat dihitung langsung dari kuantitas
stokiometri asam dan basa yang telah dibiarkan bereaksi. Pada titik kesetaraan, pH
ditetapkan oleh jauhnya air terdisiosiasi pada 250 C, pH air murni adalah 7,00.
b. Titrasi Asam Lemah dan Basa kuat
Pada kurva titrasi ini, kurva untuk suatu asam lemah mulai meningkat
dengan cepat, ketika mula-mula ditambahkan basa. Laju pertambahan mengecil

Laboratorium Dasar Teknik Kimia 1

ACIDI ALKALIMETRI
dengan bertambahnya konsentrasi B-. Larutan ini disebut terbuffer dalam daerah
dimana peningkatan pH tersebut lambat.
Perhatikan bahwa bila asam itu dinetralkan [HB] [B]

Setelah titik separuh jalan, pH naik lagi dengan lambat sampai terjadi
perubahan besar pada titik kesetaraan.
II.6 Fisis dan Chemist Reagen
1. Hidrogen Asetat (HAc) atau Asam Cuka(CH3COOH)
a. Fisis
BM : 60.05 g/mol
Densitas dan fase : 1.049 g cm3, cairan: 1.266 g cm3, padatan
TL = 16.5C TD = 118.1C
Penampilan = cairan tak berwarna atau kristal
Keasaman pKa = 4.76 pada 25C
b. Chemist
Asam asetat bersifat korosif terhadap banyak logam seperti besi,
magnesium, dan seng membentuk gas hidrogen dan garam-garam asetat
(disebut logam asetat). Aluminium merupakan logam yang tahan terhadap
korosi karena dapat membentuk lapisan aluminium oksida yang melindungi
permukaannya. Karena itu, biasanya asam asetat diangkut dengan tangki-tangki
aluminium.
2. HCl
a. Fisis:
BM = 36,47 gr/mol BJ = 1,268 gr/cc TD = 85C
TL = -110C
Kelarutan dalam 100 bagian air 0C = 82,3
Kelarutan dalam 100 bagian air 100C = 56,3
b. Chemist:
Bereaksi dengan Hg2+ membentuk endapan putih Hg2Cl2 yang tidak larut
dalam air panas dan asam encer tetapi larut dalam amoniak encer, larutan
KCN serta thiosulfat.

Laboratorium Dasar Teknik Kimia 1

ACIDI ALKALIMETRI
2 HCl + Hg2+2 H+ + Hg2Cl2
Hg2Cl2 + 2 NH3 Hg(NH4)Cl + Hg + NH4Cl
Bereaksi dengan Pb2+ membentuk endapan putih PbCl2
2 HCl + Pb2+ PbCl2 + 2 H+
Mudah menguap apalagi bila dipanaskan
Konsentrasi tidak mudah berubah karena udara/cahaya
Merupakan asam kuat karena derajat disosiasinya tinggi
3. NaOH
a. Fisis:
BM = 40 gr/mol BJ= 2,13 gr/cc
TD= 1390C
TL= 318,4C
Kelarutan dalam 100 bagian air 0C = 82,3
Kelarutan dalam 100 bagian air 100C = 56,3
b. Chemist:
Dengan Pb(NO3) membentuk endapan Pb(OH)2 yang larut dalam reagen
exess
Pb(NO)3 + NaOH Pb(OH)2+ NaNO3
Pb(OH)2 + 2 NaOH Na2PbO2 + 2 H2O
Dengan Hg2(NO3)2 membentuk endapan hitam Hg2O yang larut dalam reagen
exess
Merupakan basa yang cukup kuat
Mudah larut dalam air dan higroskopis
Mudah menyerap CO2 sehingga membentuk karbonat
4. Na2B4O7. 10H2O (Boraks)
a. Fisis:
BM= 381,43 gr/mol
BJ= 1,73 gr/ml TD= 200C TL= 75C
Kelarutan dalam 100 bagian air dingin ( 0,5C ) = 1,3
b. Chemist:
Jika ditambah H2SO4 menjadi asam boraks
Na2B4O7 + H2SO4 + 5 H2O 4 H3BO3 + Na2NO3

Laboratorium Dasar Teknik Kimia 1

ACIDI ALKALIMETRI
Jika ditambah AgNO3 menjadi endapan putih perak mutu boraks
Na2B4O7 + AgNO3 + 3H2OAgBO2 + H3BO3 +NaNO3
Jika ditambahkan BaCl2 menjadi endapan putih Ba mutu boraks
5. H2SO4
a. Fisis:
BM= 98,08 gr/mol
BJ= 1,83 gr/cc
TD= 3400C
TL= 10,440C
Kelarutan dalam 100 bagian air dingin = 80
Kelarutan dalam 100 bagian air panas = 59
b. Chemist:
Merupakan asam kuat
Jika ditambah basa membentuk garam dan air
Dengan Pb2+ membentuk PbSO4
Pb2+ + SO42-PbSO4
Dengan Ba2+ membentuk BaSO4
Ba2+ + SO42-BaSO4
6. Phenolphtalein (C20H16O4)
a. Fisis:
BM= 318,31 gr/mol
BJ= 1,299 gr/cc
TD= 261C
pH 8,0 9,6
Kelarutan dalam 100 bagian air = 8,22
b. Chemist:
Merupakan asam diprotik dan tidak berwarna.
Mula-mula berdisiosiasi menjadi bentuk tidak berwarna kemudian kehilangan
H+ menjadi ion dengan sistem terkonjugasi maka dihasilkan warna merah.

II.7 Satuan Konsentrasi

Laboratorium Dasar Teknik Kimia 1

ACIDI ALKALIMETRI
II.7.1 Molaritas (M)
Molaritas suatu larutan menyatakan jumlah mol suatu zat per liter larutan.
M=
II.7.2 Molalitas (m)
Molalitas menyatakan jumlah mol zat terlarut dalam 1 kg pelarut.
Molalitas tidak tergantung pada temperatur dan digunakan dalam bidang kimia
fisika, teristimewa dalam sifat koligatif.
Molalitas (m) =
II.7.3 Normalitas (N)
Normalitas menyatakan jumlah ekivalen zat terlarut dalam tiap liter larutan.
Ekivalen zat dalam larutan bergantung pada jenis reaksi yang dialami zat itu,
karena satuan ini dipakai dalam penyetara zat dalam reaksi.
Normalitas (N) =
Normalitas (N) = Molaritas x valensi
II.7.4 Fraksi Mol (X)
Bilangan yang menyatakan rasio jumlah mol zat terlarut dan pelarut dalam
sebuah larutan. Secara umum jika terdapat larutan AB dimana A mol zat terlarut
dan B mol zat pelarut, maka fraksi mol A (XA) adalah:
XA =
Fraksi mol zat B (XB) adalah:
XB =
Untuk jumlah kedua fraksi:
XA + XB = 1

BAB III
METODE PERCOBAAN

Laboratorium Dasar Teknik Kimia 1

ACIDI ALKALIMETRI

III.1 Bahan dan Alat yang Digunakan


Bahan
1. Boraks 0,1 N

4. Larutan Jeruk/Juice Jeruk

2. NaOH

5. HCl

3. Asam Asetat/Asam Cuka

6. Phenolptalein

Alat
1. Statif

7. Pipet Ukur

2. Klem

8. Pengaduk

3. Buret

9. Beaker Glass

4. Erlenmeyer

10. Pipet Tetes

5. Corong

11. Labu Takar

6. Pipet volum

12. Gelas Ukur

III.2 Gambar Alat

Gambar 3.1

Gambar 3.2 Corong

Gambar 3.3 Pipet Volume

(1) Statif
(2) Klem
(3) Buret
(4) Erlenmeyer

Laboratorium Dasar Teknik Kimia 1

10

ACIDI ALKALIMETRI

bar 3.4 Pipet Ukur

Gambar 3.5 Pengaduk

Gambar 3.7 Pipet Tetes

Gambar 3.6 Beaker Glass

Gambar 3.8 Labu Takar

Gambar 3.9 Gelas Ukur

III.3 Keterangan Alat


1.

Statif

: Penyangga buret

2.

Klem

: Penghubung antara statif dan buret

3.

Buret

: Sebagai tempat untuk titran

4.

Erlenmeyer : Tempat untuk analit

5.

Corong

6.

Pipet volume: Untuk mengukur volume larutan dengan ukuran tertentu

7.

Pipet ukur

: Untuk mengukur volume larutan dengan ukuran tertentu

8.

Pengaduk

: Untuk mengaduk analit

9.

Beaker glass : Tempat untuk analit

: Untuk mengalirkan larutan dari tempat besar ke tempat kecil

10. Pipet tetes

: Untuk mengambil suatu larutan

11. Labu takar

: Tempat untuk menghomogenkan/mencampur larutan

12. Gelas ukur : Untuk mengukur volume larutan

III.4 Cara Kerja


III.4.1 Standarisasi HCl dengan Boraks 0,1 N
1. Ambil 10 ml boraks 0,1 N dan masukkan ke dalam erlenmeyer.

Laboratorium Dasar Teknik Kimia 1

11

ACIDI ALKALIMETRI
2. Tambahkan beberapa tetes indikator MO.
3. Titrasi dengan HCl 0,1 N sampai warna berubah menjadi merah orange.
4. Catat kebutuhan titran.

NHCl =
III.4.2 Standarisasi NaOH dengan HCl yang Telah Distandarisasi
1. Ambil 10 ml NaOH, masukkan ke dalam erlenmeyer.
2. Tambahkan beberapa tetes indikator MO.
3. Titrasi dengan HCl sampai warna menjadi merah orange.
4. Catat volume HCl.
NNaOH =
III.4.3 Mencari Kadar Na2CO3 dan atau NaHCO3
1. Ambil sampel 10 ml larutan sampel, masukkan ke dalam erlenmeyer.
2. Tambahkan beberapa tetes indikator PP.
3. Titrasi dengan HCl sampai warna merah hampir hilang.
4. Catat kebutuhan HCl pada TAT I = x ml.
5. Tambahkan beberapa tetes indikator MO.
6. Titrasi dengan HCl sampai warna menjadi merah orange.
7. Catat kebutuhan HCl untuk Na2CO3 = y ml.
Kadar Na2CO3 =

Kadar NaHCO3 = ( y x )
III.4.4 Mencari Kadar Asam Asetat dalam Cuka
1. Ambil 5 ml cuka, encerkan sampai 100 ml aquadest.
2. Ambil 10 ml larutan sampel tersebut, masukkan ke dalam erlenmeyer.
3. Tambahkan indikator PP beberapa tetes. ( 3 tetes)
4. Titrasi dengan NaOH sampai warna merah hampir hilang.
5. Catat kebutuhan NaOH.
6. Menghitung normalitas asam sampel.
Nasam =
III.4.5 Mencari Kadar Asam Askorbat dalam Jeruk Nipis
1. Ambil 20 ml jeruk nipis, encerkan sampai 100 ml aquadest.

Laboratorium Dasar Teknik Kimia 1

12

ACIDI ALKALIMETRI
2. Ambil 10 ml larutan sampel tersebut, masukkan ke dalam erlenmeyer.
3. Tambahkan indikator PP beberapa tetes. ( 3 tetes)
4. Titrasi dengan NaOH sampai warna merah hampir hilang.
5. Catat kebutuhan NaOH.
6. Menghitung normalitas asam sampel
Nasam =
III.4.6 Mencari Kadar Asam Sitrat dalam Citrun Zuur
1. Ambil 4 gram citrun zuur, encerkan sampai 100 ml aquadest.
2. Ambil 10 ml larutan tersebut, encerkan sampai 100 ml aquadest.
3. Ambil 10 ml larutan sampel tersebut, masukkan ke dalam erlenmeyer.
4. Tambahkan indikator PP beberapa tetes. (

3 tetes)

5. Titrasi dengan NaOH sampai warrna merah hampir hilang.


6. Catat kebutuhan NaOH.
7. Menghitung kadar asam sitrat.
%asam =

BAB IV
HASIL PERCOBAAN DAN PEMBAHASAN

IV.1 Hasil Percobaan

Laboratorium Dasar Teknik Kimia 1

13

ACIDI ALKALIMETRI
Tabel 4.1 Kadar Na2CO3 pada Sampel I dan II
Kadar Na2CO3
Sampel

% Error (%)

Praktis (ppm)

Teoritis (ppm)

12.629,40

15.000

15,80

II

13.393,17

16.250

17,58

Tabel 4.2 Kadar NaHCO3 pada Sampel I dan II


Kadar NaHCO3
Sampel

% Error (%)

Praktis (ppm)

Teoritis (ppm)

9.959,57

12.000

17,00

II

10.597,24

13.000

18,48

Tabel 4.3 Kadar Asam Asetat dalam Cuka


Kadar Asam Asetat
Sampel
Cuka

Praktis

Teoritis

18,102%

25%

Tabel 4.4 Kadar Asam Sitrat dalam Citrun Zuur


Kadar Asam Sitrat
Sampel
Citrun Zuur

Praktis

Teoritis

8,918%

99,5-100%

Tabel 4.5 Kadar Asam Askorbat dalam Jeruk Nipis


Kadar Asam Askorbat
Sampel
Jeruk Nipis

Praktis

Teoritis

14,678%

0,049%

IV.2 Pembahasan
IV.2.1 Kadar Na2CO3 dan NaHCO3
Kadar praktis Na2CO3 dan NaHCO3 lebih kecil dibandingkan dengan
kadar teoritis disebabkan oleh:

Laboratorium Dasar Teknik Kimia 1

14

ACIDI ALKALIMETRI
1.

Kristal NaOH bersifat higroskopis, yaitu mudah bereaksi dengan CO2 di

udara sesuai dengan reaksi: (Michelle Wiyanty Setiawan, 2011)


2 NaOH(s) + CO2

Na2CO3(aq) + H2O(l)

(Anonim, 2013)

Kristal NaOH yang dibutuhkan dalam percobaan ini adalah 1,5 gram. Berat 1,5
gram yang diperoleh saat penimbangan tidak tepat mengandung 1,5 gram murni
kristal NaOH karena kristal tersebut mengalami kontak langsung dengan udara.
2.

Na2CO3 berasal dari natrium hidroksida yang bereaksi dengan CO2 di udara.

Natrium hidroksida selalu terkontaminasi oleh sejumlah kecil pengotor yang


paling serius di antaranya adalah natrium karbonat. Ketika CO2 diserap oleh
larutan NaOH, terjadi reaksi berikut:
CO2 + 2OH-

CO3 2- + H2O

Ion karbonat adalah basa, tetapi bereaksi dengan ion hidrogen dalam 2 tahap:
CO3 2- + H3O+

HCO3- + H2O

HCO3- + H3O+

H2CO3 + H2O

Hal ini terjadi karena Na2CO3 dititrasi dengan HCl maka TAT dengan
menggunakan indikator PP lebih kecil daripada indikator MO. Hal tersebut dapat
terjadi karena pertama Na2CO3 hanya mengambil ion H+ untuk setiap molekul
karbonat, sedangkan untuk titrasi kedua diperlukan 2 ion H+. Selisih antara
kedua titik akhir titrasi semakin kecil pula. Akibatnya apabila larutan baku basa
telah bereaksi dengan CO2 di udara maka normalitasnya lebih rendah saat
menggunakan indikator PP.
(Underwood 154 dan 157)
3.

Konsentrasi HCl mudah berubah karena HCl merupakan senyawa yang

mudah bereaksi dengan senyawa lain di udara. Hal ini mempengaruhi pada TAT
1 dan TAT 2 dari sampel yang diberikan, baik sampel 1 maupun sampel 2 sesuai
dengan reaksi:
Na2CO3 + HCl
NaHCO3 + HCl

NaHCO3 + NaCl
NaCl + H2O + CO2

(Hamilton 169)

Untuk menentukan kadar NaOH diperlukan larutan HCl, sehingga kadar


NaOH yang didapat juga akan berbeda dengan kadar teoritis. Hal ini
menyebabkan kadar dari sampel yang membutuhkan NaOH dan HCl sebagai
titran terdapat perbedaan dengan kadar teoritis.
IV.2.2 Grafik Hubungan Volume HCl vs pH

Laboratorium Dasar Teknik Kimia 1

15

ACIDI ALKALIMETRI

14
12
10
pH

8
Teoritis

Praktis

4
2
0
0

1.5

4.5

6.18 7.5

10.5 12 12.34

Volume HCl

Gambar 4.1 Grafik Hubungan Volume HCl vs pH Sampel 1

14
12

pH

10
8
Teoritis

Praktis

4
2
0
0

1.5

4.5

6.56 7.5

10.5

12 13.01

Volume HCl

Gambar 4.2 Grafik Hubungan Volume HCl vs pH Sampel 2

IV.2.3 Uji Asam Sitrat Metode Acidi Alkalimetri


Asam sitrun atau citrun zuur merupakan zat kimia yang digunakan untuk
memberi rasa asam atau mengatur keasaman makanan dan minuman. Asam
sitrun adalah nama lain dari asam sitrat dengan rumus kimia C6H8O7 atau
CH2(COOH)-COH(COOH)-CH2(COOH). Struktur asam ini tercermin pada
nama IUPAC-nya yaitu asam 2-hidroksi-1,2,3-propanatrikarboksilat. Keasaman

Laboratorium Dasar Teknik Kimia 1

16

ACIDI ALKALIMETRI
asam sitrat didapatkan dari tiga gugus karboksil COOH yang dapat melepas
proton dalam larutan. (Anonim, 2013)
Untuk mengetahui kadar dari asam sitrat, dilakukan pengujian dengan
metode alkalimetri. Langkah-langkah dalam percobaan yaitu:
1. Menyiapkan 4 gram citrun zuur dan melarutkan dengan aquadest hingga 100
ml larutan.
2. Mengambil 10 ml larutan citrun zuur yang telah diencerkan dan memasukkan
ke dalam erlenmeyer.
3. Menambahkan indikator PP beberapa tetes ( 3 tetes)
4. Menitrasi dengan NaOH hingga warna berubah menjadi merah hampir hilang.
5. Mencatat kebutuhan NaOH dan menghitung normalitas asam sitrat dalam
larutan citrun zuur.
Nasam =
Reaksi yang terjadi adalah C6H8O7 + 3 NaOH

Na3(C6H5O7) + 3 H2O.
(Anonim, 2011)

Dalam percobaan, kadar asam sitrat yang didapatkan adalah 8,918%.


Kadar yang ditemukan lebih kecil dibandingkan kadar teoritis yaitu berkisar
99,5-100,5% dalam kondisi anhidrat. (Anonim, 1995)
IV.2.4 Uji Asam Asetat dalam Cuka Metode Acidi Alkalimetri
Pada dasarnya cuka adalah larutan asam asetat (CH3COOH) dalam air.
Titrasi metode acidi alkalimetri digunakan untuk menentukan konsentrasi asetat
dalam cuka. Sebuah titrasi melibatkan larutan yang sudah diketahui
konsentrasinya (titran) dan larutan yang konsentrasinya belum diketahui (analit).
Dalam percobaan ini titran adalah NaOH 0,13356 N dan analit adalah cuka yang
telah diencerkan dengan faktor pengenceran 20x.
Ketika titrasi, terjadi netralisasi antara NaOH dengan CH3COOH dalam
cuka menurut reaksi:
NaOH + CH3COOH

NaCH3COO + H2O

Natrium hidroksida secara bertahap ditambahkan ke dalam cuka hingga semua


asam asetat dalam cuka tepat habis. Pada titik ini reaksi selesai dan tidak ada lagi
NaOH yang diperlukan. Titik ini disebut kesetaran titik reaksi.

Laboratorium Dasar Teknik Kimia 1

17

ACIDI ALKALIMETRI
Untuk mengetahui kapan titik ekivalen tercapai, ditambahkan larutan
indikator yaitu phenolpthalein pada awal titrasi. Pada titik ekivalen titrasi,
penambahan hanya satu tetes NaOH menyebabkan seluruh larutan dalam labu
erlenmeyer berubah warna dari merah muda menjadi merah merah hampir
hilang. Dari hasil percobaan, kadar asam asetat dalam cuka adalah 18,102%.
Kadar yang didapat lebih kecil dari kadar teoritisnya yaitu 25%.
(Anonim, 2012)
IV.2.5 Uji Asam Askorbat dengan Metode Acidi Alkalimetri
Asam askorbat adalah nama lain dari vitamin C. Vitamin C merupakan
vitamin yang larut dalam air dan ditemukan dalam banyak makanan. Asam
askorbat dalam konsentrasi tinggi ditemukan dalam buah jeruk, tomat, dan
sayuran hijau. Vitamin C adalah vitamin yang tidak stabil karena mudah
teroksidasi dan hilang dalam proses memasak.
Dalam larutan, asam askorbat akan bereaksi dengan NaOH menghasilkan
garam natrium askorbat dan air menurut reaksi:
HC6H7O6 + NaOH

NaC6H7O6 + H2O

Persen massa asam askorbat dapat ditentukan melalui titrasi dengan larutan
larutan NaOH. Dalam percobaan ini dilakukan pengukuran volume NaOH yang
dibutuhkan untuk menetralkan semua asam askorbat dalam sampel. Indikator
yang digunakan dalam titrasi ini adalah PP. Titrasi dihentikan saat larutan
beruba warna dari pink menjadi merah hampir hilang. (A.L Kemppainen, 2002)
Dalam percobaan ini kadar asam askorbat dalam sampel adalah 14,678%
sedangkan kadar teoritisnya adalah 0,049%.

BAB V
PENUTUP

V.1 Kesimpulan

Laboratorium Dasar Teknik Kimia 1

18

ACIDI ALKALIMETRI
1. Kadar praktis Na2CO3 dalam sampel I dan II adalah 12.629,40 ppm dan

13.393,17 ppm. Kadar teoritis Na2CO3 dalam sampel I dan II adalah 15.000
ppm dan 16.250 ppm.
2. Kadar praktis NaHCO3 dalam sampel I dan II adalah 9.959,57 ppm dan

10.597,24 ppm. Kadar teoritis NaHCO3 dalam sampel I dan II adalah


12.000 ppm dan 13.000 ppm.
3. Kadar praktis asam sitrat dalam citrun zuur adalah 8,918%, sedangkan kadar
teoritisnya sebesar 99,5-100,5%.
4. Kadar praktis asam asetat dalam cuka adalah 18,102%, sedangkan kadar
teoritisnya sebesar 25%.
5. Kadar praktis asam askorbat dalam jeruk nipis adalah 14,678%, sedangkan
kadar teoritisnya sebesar 0,049%.
6. Kadar praktis Na2CO3 dan NaHCO3 dalam sampel I dan II lebih kecil dari
kadar teoritisnya disebabkan oleh kristal NaOH bersifat higroskopis dan
konsentrasi HCl yang mudah berubah mempengaruhi TAT 1 dan TAT 2.
V.2 Saran
1. Memastikan semua alat yang akan digunakan dalam keadaan bersih.
2. Mencuci buret setiap pergantian titran.
3. Mencuci erlenmeyer setiap pergantian larutan atau zat yang akan dititrasi.
4. Segera melarutkan kristal NaOH setelah penimbangan untuk meminimalkan
reaksi dengan CO2 di udara.
5. Mengukur volume larutan dengan pipet volume untuk mendapatkan hasil
yang akurat.

DAFTAR PUSTAKA

A. L, Kemppainen. 2002. Determining Ascorbic Acid ini Vitamin C. Finlandia


University, Wadsworth Group.

Laboratorium Dasar Teknik Kimia 1

19

ACIDI ALKALIMETRI
Analysis of Vitamin C. General Chemistry Laboratories University of Alberta.
Anonim. 1995. Farmakope Indonesia edisi 4. Jakarta: Departemen Kesehatan RI.
Anonim. 2005. Buku Petunjuk Praktikum Teknik Kimia I. Laboratorium Teknologi
Proses, Jurusan Teknik Kimia Fakultas Teknik Universitas Diponegoro
Semarang.
Anonim.

2010.

Titration

of

Vinegar.

Dikutip

dari

www.smc.edu/projects/28/chemistry_10_experiments/chio_titration.pdf/
pada 16 Oktober 2013 pukul 6.57 WIB.
Anonim.

2011.

Asam

Sitrat.

Dikutip

dari

www.lab.tekim.undip.ac.id/mikrobiologi/category/kelompok_dan_materi/
pada 16 Oktober 2013 pukul 22.44 WIB.
Anonim.

2012.

Asidi

Alkalimetri.

Dikutip

dari

www.graciez_pharmacy.blogspot.com/2012/11/asidi_alkalimetry.html/ pada
14 Oktober 2013 pukul 10.28 WIB.
Anonim.

2013.

Dikutip

dari

http://repository.usu.ac.id/bitstream/123456789/4/Chapter%20II.pdf/ pada 9
Oktober 2013 pukul 16.08 WIB.
Anonim. 2013. Dikutip dari http://web.pdx.edu/~atkinsdb/tech/321/NAOH.htm pada
3 November 2013 pukul 22.04 WIB.
Day, R.A and Underwood A.L. 1986. Analisa Kimia Kuantitatif edisi 5. Jakarta:
Erlangga.
Hamilton and Simpson. 1960. Calculations of Analytical Chemistry 6th edition.
McGraw Hill Book Company.
Setiawan, Michelle Wiyanty. 2011. Larutan Standar Primer dan Sekunder. Dikutip
dari www.scribd.com/doc/49469936/Larutan-Standar-Primer-Dan-Sekunder
pada 10 Oktober 2013 pukul 6.36 WIB.

Laboratorium Dasar Teknik Kimia 1

20

ACIDI ALKALIMETRI
LEMBAR PERHITUNGAN REAGEN
NaOH
NaOH 0,15 N

= NaOH 0,15 M

Mol NaOH

= MNaOH x Volume
= 0,15 x 0,25
= 0,0375 mol

Massa NaOH

= Mol NaOH x BM NaOH


= 0,0375 x 40
= 1,5 gram

HCl

Kadar HCl = 37%


Massa HCl =
=
= 5,4199 gram
Volume HCl =

= 4,555 ml

Laboratorium Dasar Teknik Kimia 1

A-1

ACIDI ALKALIMETRI
LEMBAR PERHITUNGAN
Sampel I
TAT

Makhi

Ihsan

Brigitta

TAT 1 (x)

6,21 ml

6,13 ml

6,18 ml

TAT 2 (y)

12,27 ml

12,34 ml

12,34 ml

Kadar Na2CO3 (Makhi)

= 12.704,42 ppm
Kadar Na2CO3 (Ihsan)

= 12.540,75 ppm
Kadar Na2CO3 (Brigitta)

= 12.643,04 ppm
Kadar Na2CO3 rata-rata

=
= 12.629,40 ppm

Kadar NaHCO3 (Makhi)

= (12,27 - 6,21)
= 9.824,47 ppm

Kadar NaHCO3 (Ihsan)

= (12,34 - 6,13)
= 10.067,65 ppm

Kadar NaHCO3 (Brigitta)

= (12,34 - 6,18)
= 9.986,59 ppm

Kadar NaHCO3 rata-rata

= 9.959,57 ppm

Sampel II
TAT

Makhi

Ihsan

Brigitta

TAT 1 (x)

6,55 ml

6,53 ml

6,56 ml

TAT 2 (y)

13,15 ml

13,09 ml

13,01 ml

Kadar Na2CO3 (Makhi)

ppm

Laboratorium Dasar Teknik Kimia 1

B-1

ACIDI ALKALIMETRI
Kadar Na2CO3 (Ihsan)

= 13.359,08 ppm
Kadar Na2CO3 (Brigitta)

= 13.420,45 ppm
Kadar Na2CO3 rata-rata

=
= 13.393,17 ppm

Kadar NaHCO3 (Makhi)

= (13,15- 6,55)
= 10.699,92 ppm

Kadar NaHCO3 (Ihsan)

= (13,09 - 6,53)
= 10.635,07 ppm

Kadar NaHCO3 (Brigitta)

= (13,01 - 6,56)
= 10.456,74 ppm

Kadar NaHCO3 rata-rata

= 10.597,24 ppm

Kadar Asam Asetat pada Cuka Makanan


TAT

Makhi

Ihsan

Brigitta

Volume

11,0 ml

11,55 ml

11,31 ml

Nasam (Makhi) =
Nasam (Ihsan)

Nasam (Brigitta) =
Nasam rata-rata = 3,017 N
%

=
=
= 18,102%

Kadar Asam Askorbat pada Jeruk Nipis

Laboratorium Dasar Teknik Kimia 1

B-2

ACIDI ALKALIMETRI
TAT

Makhi

Ihsan

Brigitta

Volume

9,36 ml

9,42 ml

9,31 ml

Nasam (Makhi) =
Nasam (Ihsan) =
Nasam (Brigitta)=
%

=
=
= 14,678%

Kadar Asam Sitrat pada Citrun Zuur


TAT

Makhi

Ihsan

Brigitta

Volume

4,15 ml

4,17 ml

4,20 ml

%asam =

= 8,918%

Laboratorium Dasar Teknik Kimia 1

B-3

ACIDI ALKALIMETRI
LEMBAR PERHITUNGAN GRAFIK

Sampel I (Teoritis)

pH

TAT 1 = 6,18 ml pKa = 10,36

= 10,36 + log
= 9,337

TAT 2 = 12,34 ml pKa = 6,34

Penambahan 6,18 ml

Na2CO3= 15.000 ppm

pH

[Na2CO3] = 15.000 x

= 0,1415 N
Penambahan 0 ml

= 8,35
NaHCO3= 12.000 ppm
[NaHCO3] = 12.000

[Na2CO3] = (0,1415 x 10) - (0,22 x 0)


pH

= 1,415

Penambahan 7,5 ml

= 14 (-log 1,415)

[NaHCO3] = (0,113 x 10) - (0,22 x 1,32)

Penambahan 1,5 ml

= 0,8396
pH

[Na2CO3] = (0,1415 x 10) - (0,22 x 1,5)


= 1,085

Penambahan 9,0 ml

= 10,36 + log

[NaHCO3] = (0,113 x 10) - (0,22 x 2,82)

Penambahan 3,0 ml

= 0,5096
pH

[Na2CO3] = (0,1415 x 10) - (0,22 x 3,0)

= 6,34 + log
= 6,255

= 0,755

Penambahan 10,5 ml

= 10,36 + log

[NaHCO3] = (0,113 x 10) - (0,22 x 4,32)

= 10,418
Penambahan 4,5 ml

= 0,1796
pH

[Na2CO3] = (0,1415 x 10) - (0,22 x 4,5)

pH

= 6,34 + log
= 6,801

= 10,877

pH

= 0,113 N

= 13,151

pH

= (10,36 + 6,34)

= 6,34 + log
= 5,616

= 0,425

Penambahan 12 ml

= 10,36 + log

[NaHCO3] = (0,113 x 10) - (0,22 x 5,82)

= 11,982
Penambahan 6,0 ml
[Na2CO3] = (0,1415 x 10) - (0,22 x 6,0)
= 0,095

= -0,1504
pH

= 6,34 + log
=-

Penambahan 12,34 ml

Laboratorium Dasar Teknik Kimia 1

C-1

ACIDI ALKALIMETRI
HCO3 = (12,346,18) x 0,22

pH

= 1,3552

= 10,36 + log
= 10,099

H2CO3 = x 1,3552 = 0,6776

Penambahan 6,0 ml

H =

[Na2CO3] = (0,1533 x 10) - (0,22 x 6,0)

= 5,583.10-4

= 0,21

pH = -log [H]

pH

= 3,253

= 10,36 + log
= 9,562

Sampel II (Teoritis)

Penambahan 6,56 ml

TAT 1 = 6,56 ml pKa = 10,36

pH

= (10,36 + 6,34)

TAT 2 = 13,01 ml pKa = 6,34


= 8,35
Na2CO3= 16.250 ppm
[Na2CO3] = 16.250 x

NaHCO3= 13.000 ppm


x

[NaHCO3] = 13.000

= 0,1533 N

= 0,155 N

Penambahan 0 ml

Penambahan 7,5 ml

[Na2CO3] = (0,1533 x 10) - (0,22 x 0)

[NaHCO3] = (0,155 x 10) - (0,22 x 0,94)


= 1,3432

= 1,533
pH

= 14 (-log 1,533)

pH

= 13,186
Penambahan 1,5 ml
[Na2CO3] = (0,1533 x 10) - (0,22 x 1,5)

= 7,153
Penambahan 9,0 ml
[NaHCO3] = (0,155 x 10) - (0,22 x 2,44)

= 1,203
pH

= 10,36 + log

= 1,0132
pH

= 10,922
Penambahan 3,0 ml
[Na2CO3] = (0,1533 x 10) - (0,22 x 3,0)

= 10,36 + log
= 10,481

Penambahan 4,5 ml
[Na2CO3] = (0,1533 x 10) - (0,22 x 4,5)
= 0,543

= 6,34 + log
= 6,616

Penambahan 10,5 ml
[NaHCO3] = (0,155 x 10) - (0,22 x 3,94)

= 0,873
pH

= 6,34 + log

= 0,6832
pH

= 6,34 + log
= 6,237

Penambahan 12 ml
[NaHCO3] = (0,155 x 10) - (0,22 x 5,44)
= 0,3532

Laboratorium Dasar Teknik Kimia 1

C-2

ACIDI ALKALIMETRI
pH

= 10,390

= 6,34 + log

Penambahan 4,5 ml

= 5,810

[Na2CO3] = (0,119 x 10) - (0,193 x 4,5)

Penambahan 13,01 ml

= 0,3245

HCO3 = (13,016,56) x 0,22


pH

= 1,419

= 10,36 + log
= 9,572

H2CO3 = x 1,419 = 0,7095

Penambahan 6,0 ml

H =

[Na2CO3] = (0,119 x 10) - (0,193 x 6,0)

= 5,713.10-4

= 0,035

pH = -log [H]
pH

= 3,243

= 10,36 + log
= 8,840

Sampel I (Praktis)
TAT 1 = 6,18 ml pKa = 10,36
TAT 2 = 12,34 ml pKa = 6,34

Penambahan 6,18 ml
pH

= (10,36 + 6,34)
= 8,35

Na2CO3= 12.643,04 ppm

NaHCO3= 9.986,59 ppm


[Na2CO3] = 12.64,04 x

x
[NaHCO3] = 9.986,59

= 0,119 N
= 0,1189 N
Penambahan 0 ml

Penambahan 7,5 ml

[Na2CO3] = (0,119 x 10) - (0,193 x 0)

[NaHCO3] = (0,1189 x 10)-(0,193 x 1,32)

= 1,19
pH

= 14 (-log 1,19)

= 0,9342
pH

= 6,34 + log

= 13,077
Penambahan 1,5 ml
[Na2CO3] = (0,119 x 10) - (0,193 x 1,5)
= 0,9005

= 6,904
Penambahan 9,0 ml
[NaHCO3] = (0,1189 x 10)-(0,193 x 2,82)
= 0,6447

pH

= 10,36 + log
pH

= 6,34 + log

= 10,853
Penambahan 3,0 ml
[Na2CO3] = (0,119 x 10) - (0,193 x 3,0)
= 0,614

= 6,255
Penambahan 10,5 ml
[NaHCO3] = (0,1189 x 10)-(0,193 x 4,32)
= 0,3552

pH

= 10,36 + log
pH

= 6,34 + log

Laboratorium Dasar Teknik Kimia 1

C-3

ACIDI ALKALIMETRI
= 5,969

[Na2CO3] = (0,1266 x 10) - (0,193 x 3,0)

Penambahan 12 ml

= 0,687

[NaHCO3] = (0,1189 x 10)-(0,193 x 5,82) pH

= 10,36 + log

= 0,0657
pH

= 10,434

= 6,34 + log

Penambahan 4,5 ml

= 5,107

[Na2CO3] = (0,1266 x 10) - (0,193 x 4,5)

Penambahan 12,34 ml

= 0,3975

HCO3 = (12,346,18) x 0,193

pH

= 1,18888

= 10,36 + log
= 10,021

H2CO3 = x 1,18888 = 0,59444

Penambahan 6,0 ml

H =

[Na2CO3] = (0,1266 x 10) - (0,193 x 6,0)


= 0,108

= 5,230.10-4
pH = -log [H]

pH

= 3,282

= 10,36 + log
= 9,330

Sampel II (Praktis)

Penambahan 6,56 ml

TAT 1 = 6,56 ml pKa = 10,36

pH

= (10,36 + 6,34)

TAT 2 = 13,01 ml pKa = 6,34


= 8,35
Na2CO3= 13.420,45 ppm
[Na2CO3] = 13.420,45 x

NaHCO3= 10.456,74 ppm


x

[NaHCO3] = 10.456,74 x

= 0,1266 N

= 0,125 N

Penambahan 0 ml

Penambahan 7,5 ml

[Na2CO3] = (0,1266 x 10) - (0,193 x 0)

[NaHCO3] = (0,125 x 10)-(0,193 x 0,94)


= 1,069

= 1,266
pH

= 14 (-log 1,266)

pH

= 13,102

= 6,34 + log
= 7,110

Penambahan 1,5 ml

Penambahan 9,0 ml

[Na2CO3] = (0,1266 x 10) - (0,193 x 1,5)

[NaHCO3] = (0,125 x 10)-(0,193 x 2,44)

= 0,9765
pH

= 10,36 + log
= 10,888

Penambahan 3,0 ml

= 0,779
pH

= 6,34 + log
= 6,559

Penambahan 10,5 ml

Laboratorium Dasar Teknik Kimia 1

C-4

ACIDI ALKALIMETRI
[NaHCO3] = (0,125 x 10)-(0,193 x 3,94)
= 0,4896
pH

= 6,34 + log
= 6,149

Penambahan 12 ml
[NaHCO3] = (0,125 x 10)-(0,193 x 5,44)
= 0,200
pH

= 6,34 + log
= 5,620

Penambahan 13,01 ml
HCO3 = (13,016,56) x 0,193
= 1,24485
H2CO3 = x 1,24485 = 0,622425
H =
= 5,351.10-4
pH = -log [H]
= 3,27

Laboratorium Dasar Teknik Kimia 1

C-5

ACIDI ALKALIMETRI

LAPORAN SEMENTARA

PRAKTIKUM DASAR TEKNIK KIMIA I

Materi:

ACIDI ALKALIMETRI

NAMA

: Brigitta Bella Timang Putri

GROUP

: 1. M. Ihsan Maulana

NIM: 21030113120015

2. M. Mujahid Almakhi

LABORATORIUM DASAR TEKNIK KIMIA


TEKNIK KIMIA FAKULTAS TEKNIK
UNIVERSITAS DIPONEGORO
SEMARANG
I.

TUJUAN PERCOBAAN

Laboratorium Dasar Teknik Kimia 1

D-1

ACIDI ALKALIMETRI
a. Menganalisa kadar/konsentrasi suatu sampel (% berat, % volume, % R/V, %
M, % N).
b. Menganalisa kadar aciditas, alkalinity dari suatu sampel.
II. PERCOBAAN
2.1 Bahan yang Digunakan
1. Boraks 0,1 N
2. NaOH

4. Larutan Jeruk / Juice Jeruk


5. HCl

3. Asam Asetat / Asam Cuka

6. Phenolptalein

2.2 Alat yang Dipakai


1. Buret, statif, klem

6. Pengaduk

2. Erlenmeyer

7. Beaker Glass

3. Corong

8. Pipet Tetes

4. Pipet volum

9. Labu Takar

5. Pipet Ukur

10. Gelas Ukur

2.3 Cara Kerja


2.3.1 Standarisasi HCl dengan Boraks 0,1 N
1. Ambil 10 ml boraks 0,1 N, masukkan ke dalam erlenmeyer.
2. Tambahkan beberapa tetes indikator MO.
3. Titrasi dengan HCl 0,1 N sampai warna berubah menjadi merah orange.
4. Catat kebutuhan titran.

NHCl =
2.3.2 Standarisasi NaOH dengan HCl yang Telah Distandarisasi
1. Ambil 10 ml NaOH, masukkan ke dalam erlenmeyer.
2. Tambahkan beberapa tetes indikator MO.
3. Titrasi dengan HCl sampai warna menjadi merah orange.
4. Catat volume HCl.
NNaOH =

2.3.3 Mencari Kadar Na2CO3 dan atau NaHCO3


1. Ambil sampel 10 ml larutan sampel, masukkan ke dalam erlenmeyer.

Laboratorium Dasar Teknik Kimia 1

D-2

ACIDI ALKALIMETRI
2. Tambahkan beberapa tetes indikator PP.
3. Titrasi dengan HCl sampai warna merah hampir hilang.
4. Catat kebutuhan HCl pada TAT I = x ml.
5. Tambahkan beberapa tetes indikator MO.
6. Titrasi dengan HCl sampai warna menjadi merah orange.
7. Catat kebutuhan HCl untuk Na2CO3 = y ml.
Kadar Na2CO3 =

Kadar NaHCO3 = ( y x )
2.3.4 Mencari Kadar Asam Asetat
1. Ambil 5 ml cuka, encerkan sampai 100 ml aquadest.
2. Ambil 10 ml larutan sampel tersebut, masukkan ke dalam erlenmeyer.
3. Tambahkan indikator PP beberapa tetes. ( 3 tetes)
4. Titrasi dengan NaOH sampai warna merah hampir hilang.
5. Catat kebutuhan NaOH.
6. Menghitung normalitas asam sampel.
Nasam =
2.3.5 Mencari Kadar Asam Askorbat dalam Jeruk Nipis
1. Ambil 20 ml jeruk nipis, encerkan sampai 100 ml aquadest.
2. Ambil 10 ml larutan sampel tersebut, masukkan ke dalam erlenmeyer.
3. Tambahkan indikator PP beberapa tetes. ( 3 tetes)
4. Titrasi dengan NaOH sampai warna merah hampir hilang.
5. Catat kebutuhan NaOH.
6. Menghitung normalitas asam sampel.
Nasam =
2.3.6 Mencari Kadar Asam Sitrat pada Citrun Zuur
1. Ambil 4 gram citrun zuur, encerkan sampai 100 ml aquadest.
2. Ambil 10 ml larutan tersebut, encerkan sampai 100 ml aquadest.
3. Ambil 10 ml larutan sampel tersebut, masukkan ke dalam erlenmeyer.
4. Tambahkan indikator PP beberapa tetes. (

3 tetes)

5. Titrasi dengan NaOH sampai warrna merah hampir hilang.

Laboratorium Dasar Teknik Kimia 1

D-3

ACIDI ALKALIMETRI
6. Catat kebutuhan NaOH.
7. Menghitung kadar asam sitrat.
%asam =

2.4 Hasil Percobaan


2.4.1 Standarisasi HCl dengan Boraks 0,1 N

NHCl =
2.4.2 Standarisasi NaOH dengan HCl yang Telah Distandarisasi
NNaOH =
2.4.3 Kadar Na2CO3 dan NaHCO3
Sampel I
TAT

Makhi

Ihsan

Brigitta

TAT 1 (x)

6,21 ml

6,13 ml

6,18 ml

TAT 2 (y)

12,27 ml

12,34 ml

12,34 ml

Kadar Na2CO3

= 12.643,04 ppm
Kadar NaHCO3 = (12,34 - 6,18)
= 9.986,59 ppm
Sampel II
TAT

Makhi

Ihsan

Brigitta

TAT 1 (x)

6,55 ml

6,53 ml

6,56 ml

TAT 2 (y)

13,15 ml

13,09 ml

13,01 ml

Kadar Na2CO3

= 13.420,45 ppm
Kadar NaHCO3 = (13,01 - 6,56)
= 10.456,74 ppm
2.4.4 Kadar Asam Asetat pada Cuka Makanan
TAT

Makhi

Ihsan

Laboratorium Dasar Teknik Kimia 1

Brigitta

D-4

ACIDI ALKALIMETRI
Volume

11,0 ml

Nasam

11,55 ml

11,31 ml

=
= 18,12%
2.4.5 Kadar Asam Askorbat pada Jeruk Nipis
TAT

Makhi

Ihsan

Brigitta

Volume

9,36 ml

9,42 ml

9,31 ml

Nasam

=
=
= 14,59%

2.4.6 Kadar Asam Sitrat pada Citrun Zuur


TAT

Makhi

Ihsan

Brigitta

Volume

4,15 ml

4,17 ml

4,20 ml

%asam

= 8,98%

MENGETAHUI
PRAKTIKAN

ASISTEN

Brigitta Bella

Dani Puji Utomo

Laboratorium Dasar Teknik Kimia 1

D-5

ACIDI ALKALIMETRI
LEMBAR KUANTITAS REAGEN

Materi

: Acidi Alkalimetri

Hari/Tanggal

: Kamis, 3 September 2013

Kelompok

: 2 Rabu Pagi

Nama

: 1. Brigitta Bella T.P


2. M. Ihsan Maulana
3. M. Mujahid Almakhi

Asisten

: Dani Puji Utomo

KUANTITAS REAGEN
No

Jenis Reagen

Kuantitas

1.

NaOH 0,15 N

250 ml

2.

HCl 0,22 N

250 ml

3.

Sari jeruk nipis

20 ml

4.

Cuka makanan

5 ml

5.

Citrun zuur

4 gram

TUGAS TAMBAHAN:
- Standar mutu cuka makanan
- Kandungan vitamin C dalam jeruk
- Standar citrun/asam sitrun
CATATAN:

Semarang, 3 September 2013


Asisten,

Dani Puji Utomo

Laboratorium Dasar Teknik Kimia 1

E-1

ACIDI ALKALIMETRI
REFERENSI

http://yessykh.blogspot.com/2011/12/kimia-analisis.html

repository.usu.ac.id/bitstream/123456789/20306/4/Chapter%20II.pdf

Laboratorium Dasar Teknik Kimia 1

F-1

ACIDI ALKALIMETRI

http://www.smc.edu/projects/28/chemistry_10_experiments/ch10_titration.pdf

www.scribd.com/doc/49469936/Larutann-Standar-Primer-Dan-Sekunder

Laboratorium Dasar Teknik Kimia 1

F-2

ACIDI ALKALIMETRI

http://graciez-pharmacy.blogspot.com/2012/11/asidi-alkalimetri.html

web.pdx.edu/~atkinsdb/teach/321/NAOH.htm

Laboratorium Dasar Teknik Kimia 1

F-3

ACIDI ALKALIMETRI

lab.tekim.undip.ac.id/mikrobiologi/category/articles/buku-panduan-mikrobiologi2013/ASAM-SITRAT1.pdf

Laboratorium Dasar Teknik Kimia 1

F-4

ACIDI ALKALIMETRI

Laboratorium Dasar Teknik Kimia 1

F-5

ACIDI ALKALIMETRI

Laboratorium Dasar Teknik Kimia 1

F-6

ACIDI ALKALIMETRI
DIPERIKSA
NO

TANGGAL

P1

10 Desember 2013

KETERANGAN
- Perbaiki judul
(Cover Hal Pengesahan)
- Perbaiki Halaman
- Perbaiki Bab III & IV

P2

15 Desember 2013

- Perbaiki Cover

15 Desember 2013

ACC

Laboratorium Dasar Teknik Kimia 1

TANDA TANGAN