Anda di halaman 1dari 28

No. Dokumen FM.

03/SMAN1DEMAK/KUR
SMA NEGERI 1 DEMAK
Tanggal 17 DESEMBER 2013
No. Edisi / No.
0/0
Revisi
RPP
Halaman 1 / 25

RENCANA PELAKSANAAN PEMBELAJARAN (RPP)

Nama Satuan Pendidikan : SMA N 1 Demak


Mata Pelajaran : Kimia
Kelas/Semester : XI /Satu
Materi Pokok : Hidrokarbon dan minyak bumi
Alokasi Waktu : 26 x 45 menit (13x pertemuan)
A. Kompetensi Inti
KI 1 : Menghayati dan mengamalkan ajaran agama yang dianutnya.
KI 2 : Menghayati dan mengamalkan perilaku jujur, disiplin, tanggung jawab, peduli
(gotong royong, kerjasama, toleran, damai), santun, responsif dan proaktif, dan
menunjukan sikap sebagai bagian dari solusi atas berbagai permasalahan dalam
berinteraksi secara efektif dengan lingkungan sosial dan alam serta dalam
menempatkan diri sebagai cerminan bangsa dalam pergaulan dunia.
KI 3 : Memahami, menerapkan, dan menganalisis pengetahuan faktual, konseptual,
prosedural, dan metakognitif berdasarkan rasa ingin tahunya tentang ilmu
pengetahuan, teknologi, seni, budaya, dan humaniora dengan wawasan
kemanusiaan, kebangsaan, kenegaraan, dan peradaban terkait penyebab fenomena
dan kejadian, serta menerapkan pengetahuan prosedural pada bidang kajian yang
spesifik sesuai dengan bakat dan minatnya untuk memecahkan masalah.
KI 4 : Mengolah, menalar, dan menyaji dalam ranah konkret dan ranah abstrak terkait
dengan pengembangan dari yang dipelajarinya di sekolah secara mandiri,
bertindak secara efektif dan kreatif, serta mampu menggunakan metoda sesuai
kaidah keilmuan.
B. Kompetensi Dasar dan Indikator
No Kompetensi Dasar Indikator Pencapaian Kompetensi
1. 3.1.1 Mendeskripsikan kekhasan atom karbon
3.1 Menganalisis struktur dan sifat
senyawa hidrokarbon dalam senyawa karbon
berdasarkan pemahaman
3.1.2 Membedakan atom C primer, sekunder,
kekhasan atom karbon dan
penggolongan senyawanya tertier dan kuarterner.
3.1.3 Mengelompokkan senyawa hidrokarbon
berdasarkan kejenuhan ikatan
3.1.4 Memberi nama senyawa alkana, alkena dan
alkuna.
3.1.5 Mendeskripsikan sifat fisik alkana, alkena,
dan alkuna
2. 3.2. Memahami proses 3.2.1.Mengemukakan proses pembentukan minyak
pembentukan dan teknik
bumi
pemisahan fraksi-fraksi minyak
bumi serta kegunaannya. 3.2.2.Mengemukakan teknik pemisahan minyak
bumi menjadi fraksi -fraksinya
3.2.3.Mengemukakan kegunaan fraksi fraksi minyak
bumi.
3.2.4.Mengemukakan kualitas bensin berdasarkan
bilangan oktannya
3.2.5.Mengemukakan cara menaikan bilangan Oktan
dalam Bensin dan Efek nya
3. 3.3.Mengevaluasi dampak 3.3.1.Menjelaskan tentang dampak pembakaran
pembakaran senyawa
senyawa hidrokarbon terhadap lingkungan dan
hidrokarbon terhadap
lingkungan dan kesehatan serta kesehatan serta cara mengatasinya.
cara mengatasinya.
4. 4.1 Menemukan berbagai struktur 4.1.1 Mengidentifikasi unsur C, H dan O dalam
molekul hidrokarbon dari
senyawa hidrokarbon
rumus molekul yang sama dan
memvisualisasikannya 4.1.2 Mendeskripsikan isomer pada alkana, alkena,
dan alkuna
4.1.3 Menuliskan reaksi sederhana pada senyawa
alkana, alkena dan alkuna (reaksi oksidasi,
reaksi adisi, reaksi substitusi, dan reaksi
eliminasi)
5. 4.2.Menyajikan hasil pemahaman 4.2.1.Menjelaskan dan menyajikan hasil pemahaman
tentang proses pembentukan
tentang proses pembentukan dan teknik
dan teknik pemisahan fraksi-
fraksi minyak bumi beserta pemisahan fraksi-fraksi minyak bumi be-serta
kegunaannya
kegunaannya
6. 4.3.Menyajikan hasil evaluasi 4.3.1.Mengemukakan cara penyelesaian tentang
dampak pembakaran
dampak pembakaran senyawa hidrokarbon
hidrokarbon terhadap
lingkungan dan kesehatan serta terhadap lingkungan dan kesehatan serta cara
upaya untuk mengatasinya.
mengatasinya.
C. TUJUAN
Melalui model pembelajaran inkuiri terbimbing dengan menggali informasi dari
berbagai sumber belajar, dan mengolah informasi, diharapkan siswa terlibat aktif selama
proses belajar mengajar berlangsung, memiliki sikap ingin tahu, teliti dalam melakukan
pengamatan dan bertanggungjawab dalam menyampaikan pendapat, menjawab pertanyaan,
memberi saran dan kritik, serta dapat menganalisis data hasil percobaan identifikasi unsur
karbon pada senyawa hidrokarbon, serta dapat mengomunikasikan data hasil penelusuran
informasi dan percobaan sederhana. Melalui kegiatan diskusi kelas setiap kelompok
menyampaikan hasil diskusinya, jika ada kelompok yang kurang tepat dalam menjawab maka
kelompok lainnya dapat saling melengkapi, hal ini memberikan pembelajaran pada siswa
untuk dapat menghargai pendapat temannya.

D. Materi Pembelajaran
1. Kekhasan atom karbon
2. Penggolongan hidrokarbon
3. Sifat fisika dan kimia hidrokarbon
4. Keisomeran hidrokarbon
5. Proses pembentukan dan teknik pemisahan fraksi-fraksi minyak bumi, kegunaan dan
dampaknya.

E. Metode Pembelajaran
Model : Inkuiri terbimbing
Metode : ceramah dan diskusi kelompok
Pendekatan : Saintifik

F. Media , Alat dan Sumber Pembelajaran


1. Media
a. Lembar Kerja Siswa
b. Power Point
2. Alat dan Bahan
a. Laptop
b. LCD
c. Bahan Demonstrasi
3. Sumber Belajar
a. Buku Kimia SMA Kelas XI Kurikulum 2013
b. Buku Kimia sumber lain yang relevan
c. Internet
G. Kegiatan Pembelajaran pertemuan 1 (kekhasan atom karbon)
Langkah Inkuiri Alokasi
Kegiatan Aktivitas
Terbimbing Waktu
Pendahuluan 1. Guru melakukan pembukaan
dengan salam pembuka secara 10 menit
menyenangkan.
2. Siswa perwakilan memimpin
doa menurut keyakinan masing- Religius
masing untuk menumbuhkan
Sikap sikap religius.
Disiplin 3. Guru mengkondisikan siswa
dengan memeriksa kehadiran
siswa.
Apersepsi 1. Guru memberikan apersepsi
dengan memberikan pertanyaan
ketika udara dingin seperti di
puncak yang biasa dilakukan
adalah membuat api unggun atau
membakar jagung adakah disini
yang suka jagung bakar? Nah
sekarang jika jagung dan kayu
yang dibakar terlalu lama apa yang
terjadi? Siapakah yang ingin
Critical
memakannya? Thinking
Menjadi hitam bu, iya benar
adakah yang tau mengapa bisa
menjadi hitam?
Karena terdapat carbon (arang)
yang merupakan atom paling
banyak menyusun tubuh makhluk
hidup dan alam semesta sehingga
ketika dibakar akan menjadi arang
atau berwarna hitam.
2. Guru menjelaskan kepada siswa
mengenai tujuan dari
pembelajaran. mendeskripsikan
kekhasan atom karbon dalam
senyawa karbon dan
mengidenttifikasi unsur C, H dan O
dalam senyawa karbon
Motivasi 1. Guru memberi motivasi kepada
siswa mengenai materi yang
akan dipelajari beserta
manfaatnya dalam kehidupan
sehari-hari seperti manfaat
bahan bakar untuk kendaraan
dan lain-lain.
2. Guru mengkomunikasikan lebih
lanjut mengenai tujuan,
kompetensi dasar, dan indikator
pencapaian
Kegiatan inti 1. Orientasi 1. Guru membagi siswa dalam
70 menit
beberapa kelompok secara acak
dan duduk sesuai dengan
kelompok yang telah dibagi,
misalnya dibagi 5 kelompok.
Guru menjelaskan poin-poin
penting pada materi
pembelajaran hari ini (kekhasan
atom karbon dan
mengidenttifikasi unsur C, H dan
O dalam senyawa karbon). Guru
memberikan pertanyaan
Bagaimana ciri khas dari atom
karbon?
2. Siswa mengkaji literatur
tentang kekhasan atom karbon
dan identifikasi unsur C, H dan O
dalam senyawa karbon. Siswa
menerima lembar diskusi.

2. Rumusan 1. Siswa dipancing rasa ingin tahu


Masalah terhadap materi pembelajaran
sehingga dapat merumuskan
masalah. Guru mengarahkan
siswa untuk mengajukan
pertanyaan, di antaranya
tentang :
Bagaimana identifikasi unsur
C, H dan O dalam senyawa
hidrokarbon?
Apa saja ciri senyawa
hidrokarbon yang di dalamnya
terdapat unsur C, H dan O?
Apa saja keunikan atau
Kerja sama kekhasan atom karbon?

3. Mengajukan 1. Siswa melakukan diskusi


hipotesis kelompok dengan mengajukan
hipotesis berdasarkan
permasalahan yang dirumuskan
seperti,
Identifikasi unsur C, H dan O
dalam senyawa hidrokarbon
dengan pembakaran
senyawa karbon

1. Siswa melakukan percobaan Jujur, teliti,


bertanggungjawab
4. Mengumpulkan kelompok mencari
data penyelesaian dari pertanyaan
pada lembar praktikum dengan
menacari literatur pada buku
paket atau internet.
2. Guru membimbing dan
memfasillitasi kelompok untuk
menyelesaikan hipotesis yang
diajukan.

Siswa secara kelompok diminta


5. Penyimpulan menyimpulkan hasil praktikum yang
dilakukan. Menyampaikan hasil
Menghargai
pendapat teman hasil diskusi kelompok. Kelompok
lain diberikan kesempatan untuk
memberikan tanggapan dari hasil
kelompok penyaji.
1. Guru dan siswa mereview hasil 10 menit
Penutup
kegiatan pembelajaran serta
menghubungkan
pengaplikasian dalam
lingkungan sekitar.
2. Guru memberikan tugas siswa
dengan penuh tanggung jawab
untuk mengerjakan soal yang
berkaitan dengan materi yang
dipelajari dan mempelajari
pengelompokkan hidrokarbon.
3. Guru mengakhiri kegiatan
belajar dengan memberikan
pesan untuk tetap belajar
4. Guru menutup pembelajaran
dengan berdoa dan
mengucapkan salam untuk
menanamkan religius pada
siswa.
Kegiatan pembelajaran pertemuan ke 2 sampai 5 (penggolongan hidrokarbon)
Kegiatan Aktivitas Alokasi
Langkah
Waktu
Pendahuluan 1. Guru melakukan pembukaan 40 menit
dengan salam pembuka secara
menyenangkan. Religius
2. Siswa perwakilan memimpin
doa menurut keyakinan
masing-masing untuk
menumbuhkan sikap religius.
Sikap 3. Guru mengkondisikan siswa
Disiplin
dengan memeriksa kehadiran
siswa.
Apersepsi 1. Guru memberikan apersepsi
dengan memberikan pertanyaan
kemarin kita sudah
mempelajari keunikan atau
kekhasan atom kabon dan
klasifikasinya, sebutkan salah
satu kekhasan atom karbon?
Memiliki valensi 4 (4 tangan
Menumbuhkan ikatan), dari 4 tangan ikatan ini
rasa ingin tahu
siswa dapat membetuk berbagai
struktur karbon yang sangat
banyak. Sehingga hidrokarbon
dikelompokkan berdasarkan
jenis ikatan dan bentuk ikatan
Motivasi 1. Guru memberi motivasi
kepada siswa mengenai materi
yang akan dipelajari beserta
manfaatnya dalam kehidupan
sehari-hari seperti plastik, lilin,
dan bahan bakar (propana dan
butana).
2. Guru mengkomunikasikan
lebih lanjut mengenai tujuan,
kompetensi dasar,dan indikator
pencapaian
Kegiatan inti 1. Orientasi 1. Guru menjelaskan poin-poin
280
penting pada materi menit
Critical Thinking, (Memprediksi dan
Mengidentifikasi Tujuan) pembelajaran hari ini
(pengelompokan hidrokarbon).
2. Siswa memperhatikan
penjelasan guru. Melalui
tanyangan video. Kemudian
guru bertanya apa bahan bakar
yang sering ibu gunakan di
rumah untuk memasak?. Apa
sajakah kandungannya?

1. Siswa diminta untuk mencari


2. Rumusan
informasi mengenai
Masalah
pengelompokan senyawa
hidrokarbon dalam buku/modul.
2. Siswa dipancing rasa ingin
tahu terhadap materi
pembelajaran sehingga dapat
merumuskan masalah. Guru
mengarahkan siswa untuk
mengajukan pertanyaan, di
antaranya tentang :
Apa dasar pengelompokan
senyawa hidrokarbon?
Bagaimana penamaan pada
senyawa hidrokaron?
3. Mengajukan
Siswa melakukan diskusi kelompok
hipotesis
dengan mengajukan hipotesis
berdasarkan permasalahan yang
dirumuskan seperti,
Pengelompokan hidrokarbon
berdasarkan bentuk ikatan
rantai karbon dan jenis ikatan
rantai karbon (jenuh dan tak
jenuh).

1. Pada pertemuan hari ini akan


4. Mengumpulkan
membahas hidrokarbon
data Jujur,
berdasarkan jenis ikatannya bertanggungjawab
(alkana, alkena dan alkuna).
2. Siswa secara berpasangan
mencari penyelesaian dari
pertanyaan pada kartu yang
dibagikan oleh guru. Kemudian
siswa harus mencari pasangan
kartu yang isinya struktur
Kerja sama molekul yang akan diberi nama
senyawanya atau sebailknya.
3. Setiap pasangan diskusi diminta
untuk mendiskusikan HOTS(meningkat
kan pemahaman
pengelompokan senyawa siswa)
hidrokarbon berdasarkan jenis
ikatannya.
4. Guru membimbing dan
memfasillitasi kelompok untuk
menyelesaikan hipotesis yang
diajukan.
5. Guru memberikan kuis
tambahan melalui aplikasi
hyperchem pada siswa untuk
menyelesaikannya. Siswa yang
bisa menjawab akan mendapat
piont plus.

5. Penyimpulan Siswa secara kelompok diminta


menyimpulkan hasil pekerjaannya.
Menghargai Siswa menuliskan hasil diskusi di
pendapat teman
papan tulis. Kelompok lain
diberikan kesempatan untuk
memberikan tanggapan.
Penutup 1. Guru dan siswa mereview dan 40 menit
menyimpulkan hasil kegiatan
pembelajaran.
2. Guru memberikan tugas siswa
dengan penuh tanggung jawab
untuk mengerjakan soal yang
berkaitan dengan materi yang
dipelajari.
3. Guru mengakhiri kegiatan
belajar dengan memberikan
pesan untuk tetap belajar
4. Guru menutup pembelajaran
dengan berdoa dan
mengucapkan salam untuk
menanamkan religius pada
siswa.
Kegiatan pembelajaran pertemuan ke 6 dan 7 (Sifat Fisik dan Kimia Hidrokarbon)

Kegiatan Aktivitas Alokasi


Langkah
Waktu
Pendahuluan 1. Guru melakukan pembukaan 20 menit
dengan salam pembuka secara
menyenangkan. Religius
2. Siswa perwakilan memimpin
doa menurut keyakinan
masing-masing untuk
menumbuhkan sikap religius.
Sikap 3. Guru mengkondisikan siswa
Disiplin
dengan memeriksa kehadiran
siswa sebagai sikap disiplin.
Apersepsi 1. Guru memberikan apersepsi
dengan memberikan pertanyaan
kemarin kita sudah
Critical Thinking, (Memprediksi dan
Mengidentifikasi Tujuan)
mempelajari bentuk dan jenis
ikatan hidrokarbon, apa
dampak dari perbedaan ini?
Motivasi 1. Guru memberi motivasi
kepada siswa mengenai materi
yang akan dipelajari beserta
manfaatnya dalam kehidupan
sehari-hari.
2. Guru mengkomunikasikan
lebih lanjut mengenai tujuan,
kompetensi dasar, indikator
pencapaian dan model
pembelajaran kepada siswa
Kegiatan inti 1. Orientasi 1. Guru menjelaskan poin-poin
140
penting pada materi menit
pembelajaran hari ini (sifat
fisika kimia senyawa
hidrokarbon). Guru membagi
siswa menjadi kelompok yang
terdiri dari 3-4 siswa. Critical
Thinking
2. Siswa diminta untuk mencari
informasi mengenai sifat fisik
alkana alkena dan alkuna. Siswa
diminta menganalisis tabel titik
didih dan titik beku beberapa
senyawa hidrokarbon

2. Rumusan 1. Siswa dipancing rasa ingin


Masalah tahu terhadap materi
pembelajaran sehingga dapat
merumuskan masalah. Guru
mengarahkan siswa untuk
mengajukan pertanyaan, di
antaranya tentang :
Apa yang membedakan titik
didih dan titik lebur suatu
senyawa hidrokarbon?

3. Mengajukan 1. Siswa melakukan diskusi


hipotesis kelompok dengan mengajukan Jujur,
hipotesis berdasarkan bertanggungjawab
permasalahan yang
dirumuskan seperti,
Perbedaan titik didih
senyawa hidrokarbon
dikarenakan perbedaan
jumlah rantai karbonnya.

4. Mengumpulkan 1. Siswa secara berkelompok


data mencari penyelesaian dari
lembar diskusi siswa yang
Kerja sama
dibagikan oleh guru. Setiap
pasangan diskusi diminta untuk
mendiskusikan sifat senyawa
hidrokarbon.
2. Guru membimbing dan
memfasillitasi kelompok untuk
menyelesaikan hipotesis yang
diajukan.

5. Penyimpulan Siswa secara kelompok diminta


menyimpulkan hasil pekerjaannya.
Menghargai Siswa mempresentasikan hasil
pendapat teman diskusi di depan kelas. Kelompok
lain diberikan kesempatan untuk
memberikan tanggapan dari hasil
kelompok penyaji.
1. Guru dan siswa mereview 20 menit
Penutup
hasil kegiatan pembelajaran
serta menghubungkan
pengaplikasian dalam
lingkungan sekitar.
2. Guru memberikan tugas siswa
dengan penuh tanggung jawab
untuk mengerjakan soal yang
berkaitan dengan materi yang
dipelajari.
3. Guru mengakhiri kegiatan
belajar dengan memberikan
pesan untuk tetap belajar
4. Guru menutup pembelajaran
dengan berdoa dan
mengucapkan salam untuk
menanamkan religius pada
siswa.

Kegiatan pembelajaran pertemuan ke 8 sampai 10

Kegiatan Aktivitas Alokasi


Langkah
Waktu
Pendahuluan 1. Guru melakukan pembukaan
dengan salam pembuka secara 30 menit
menyenangkan.
2. Siswa perwakilan memimpin 7 menit
Religius
doa menurut keyakinan
masing-masing untuk
menumbuhkan sikap religius.
Sikap 3. Guru mengkondisikan siswa
Disiplin dengan memeriksa kehadiran
siswa sebagai sikap disiplin.
Apersepsi 1. Guru memberikan apersepsi
dengan memberikan pertanyaan
Menumbuhkan adakah yang suka cake?atau
rasa ingin tahu
siswa cup cake? Apa yang berbeda
dari keduanya? Yang
membedakan yaitu bentuknya,
dimana komposisi adonan
yang dibuat sama dan
takarannya sama dan yang
membedakan pula tambahan
untuk memberikan rasa yang
berbeda-beda. Hal ini
berhubungan dengan
keisomeran senyawa
hidrokarbon.
Motivasi 1. Guru memberi motivasi
kepada siswa mengenai materi
yang akan dipelajari beserta
manfaatnya dalam kehidupan
sehari-hari.
2. Guru mengkomunikasikan
lebih lanjut mengenai tujuan,
kompetensi dasar, dan
indikator pencapaian
Kegiatan inti 1. Orientasi 1. Guru menjelaskan mengenai
210
reaksi alkana, alkena, dan menit
alkuna menggunakan peta reaksi
dan memprediksikan produk Critical
Thinking
yang diperoleh.
2. Siswa diminta meminta untuk
mencari informasi mengenai
isomer pada alkana, dan alkena.

Siswa dipancing rasa ingin tahu


2. Rumusan
terhadap materi pembelajaran
Masalah
sehingga dapat merumuskan
masalah. Guru mengarahkan siswa
untuk mengajukan pertanyaan, di
antaranya tentang :
Apa yang membedakan
keisomeran senyawa
hidrokaron?

3. Mengajukan Siswa melakukan diskusi


hipotesis kelompok dengan mengajukan
hipotesis berdasarkan
Kerja sama permasalahan yang dirumuskan
seperti,
Perbedaan keisomeran
senyawa hidrokarbon
dikarenakan perbedaan posisi
dan rangka.

1. Siswa secara berpasangan


4. Mengumpulkan mencari penyelesaian dari
data Jujur,
kartu yang dibagikan oleh bertanggungjawab
guru. Setiap pasangan diskusi
diminta untuk mendiskusikan
isomer senyawa hidrokarbon.
2. Guru membimbing dan
memfasillitasi kelompok untuk
menyelesaikan hipotesis yang
diajukan.

5. Penyimpulan Siswa secara berpasangan diminta


menyimpulkan hasil pekerjaannya.
Menghargai Siswa mempresentasikan hasil
pendapat teman diskusi di depan kelas. Kelompok
lain diberikan kesempatan untuk
memberikan tanggapan dari hasil
kelompok penyaji.
Penutup 1. Guru dan siswa mereview 30 menit
hasil kegiatan pembelajaran
serta menghubungkan
pengaplikasian dalam
lingkungan sekitar.
2. Guru memberikan tugas siswa
dengan penuh tanggung jawab
untuk mengerjakan soal yang
berkaitan dengan materi yang
dipelajari.
3. Guru mengakhiri kegiatan
belajar dengan memberikan
pesan untuk tetap belajar
4. Guru menutup pembelajaran
dengan berdoa dan
mengucapkan salam untuk
menanamkan religius pada
siswa.
Kegiatan Pembelajaran Pertemuan 11-13 (Minyak bumi dan dampak pembakaran)
Kegiatan Aktivitas Alokasi
Langkah
Waktu
Pendahuluan 1. Guru melakukan pembukaan
dengan salam pembuka secara 30 menit
menyenangkan.
2. Siswa perwakilan memimpin 7 menit
Religius
doa menurut keyakinan
masing-masing untuk
menumbuhkan sikap religius.
Sikap 3. Guru mengkondisikan siswa
Disiplin dengan memeriksa kehadiran
siswa sebagai sikap disiplin.
Apersepsi 1. Guru memberikan apersepsi
dengan memberikan
pertanyaan adakah Bahan
bakar apa yang digunakan
dalam kendaraan bermotor ?
dan bagaimana cara
memperolehnya ?. Hal ini
berhubungan dengan minyak
bumi.
Motivasi 1. Guru memberi motivasi
kepada siswa mengenai materi
yang akan dipelajari beserta
manfaatnya dalam kehidupan
sehari-hari.
2. Guru mengkomunikasikan
lebih lanjut mengenai tujuan,
kompetensi dasar, dan
indikator pencapaian
Kegiatan inti 1. Orientasi 1. Siswa memperhatikan gambar
210
produk-produk yang bersumber menit
dari minyak bumi dan gas alam,
seperti gas LPG, BBM, lilin, Critical
Thinking
cat, pelumas, tar, dan lain-lain.

2. Rumusan 1. Siswa dipancing rasa ingin


Masalah tahu terhadap materi
pembelajaran sehingga dapat
merumuskan masalah. Guru
mengarahkan siswa untuk
mengajukan pertanyaan, di
antaranya tentang :
Bagaimana proses pembuatan
produk-produk yang telah
ditampilkan?
Apa saja manfaat minyak
bumi selain itu?
Bagaimana dampak dari
pembakaran bahan bakar yang
bersumber dari minyak bumi?
Apa alternatif untuk
mengganti bahan bakar yang
bersumber dari energi fosil?

3. Mengajukan Siswa melakukan diskusi


hipotesis kelompok dengan mengajukan
hipotesis berdasarkan
Kerja sama
permasalahan yang dirumuskan
seperti,
Proses pembuatan produk-
produk tersebut dengan cara
penyulingan.
Pembakaran bahan bakar
mengakibatkan pencemaran
udara

4. Mengumpulkan 1. Guru membimbing dan


data memfasillitasi kelompok untuk
Jujur,
menyelesaikan hipotesis yang bertanggungjawab
diajukan.
2. Setiap kelompok siswa
mendiskusikan mengenai
proses pembentukan dan
pengolahan minyak bumi dan
gas alam.

5. Penyimpulan 1. Siswa menuliskan hasil


diskusinya pada kertas folio
Menghargai yang telah disediakan
pendapat teman sebelumnya.
2. Siswa secara berpasangan
diminta menyimpulkan hasil
pekerjaannya.
3. Siswa mempresentasikan hasil
diskusi di depan kelas.
Kelompok lain diberikan
kesempatan untuk memberikan
tanggapan dari hasil kelompok
penyaji.
Penutup 1. Guru dan siswa mereview 30 menit
hasil kegiatan pembelajaran
serta menghubungkan
pengaplikasian dalam
lingkungan sekitar.
2. Guru memberikan tugas siswa
dengan penuh tanggung jawab
untuk mengerjakan soal yang
berkaitan dengan materi yang
dipelajari.
3. Guru mengakhiri kegiatan
belajar dengan memberikan
pesan untuk tetap belajar.
4. Guru menutup pembelajaran
dengan berdoa dan
mengucapkan salam untuk
menanamkan religius pada
siswa.

H. Penilaian
1. Jenis/Teknik penilaian

Aspek Mekanisme dan Instrumen Ketera-


No. Prosedur ngan
1. Kognitif 1. Penugasan 1. Soal penugasan -
2. Tes tertulis 2. Soal objektif
2. Afektif 1. Observasi kerja 1. Lembar observasi -
kelompok
3. Psikomotorik 1. Kinerja presentasi 1. Kinerja presentasi -
2. Laporan praktik 2. Rubrik penilaian
2. Remedial dan Pengayaan

No Aspek Teknik
1. Remedial a. Pembelajaran remedial dilakukan bagi peserta didik yang
capaian KD nya belum tuntas
b. Tahapan pembelajaran remedial dilaksanakan melalui remidial
teaching (klasikal), atau tutor sebaya, atau tugas dan diakhiri
dengan tes.
c. Tes remedial, dilakukan sebanyak 3 kali dan apabila setelah 3
kali tes remedial belum mencapai ketuntasan, maka remedial
dilakukan dalam bentuk tugas tanpa tes tertulis kembali.
2. Pengayaan a. Bagi peserta didik yang sudah mencapai nilai ketuntasan
diberikan pembelajaran pengayaan sebagai berikut:
- Siwa yang mencapai nilai n(ketuntasan) n n(maksimum)
diberikan materi masih dalam cakupan KD dengan
pendalaman sebagai pengetahuan tambahan
- Siwa yang mencapai nilai n n(maksimum) diberikan materi
melebihi cakupan KD dengan pendalaman sebagai
pengetahuan tambahan.

Demak, Juli 2017


Mengetahui,
Kepala SMA Negeri 1 Demak, Guru Mata Pelajaran Kimia,

Suntono, S.Pd. M.Pd. Sri Astuti, S.Pd.


NIP 19631110 1994121003 NIP 19650113 1990032003
Lampiran 1
Lembar Diskusi Siswa

ORIENTASI

Gambar di samping adalah proses


pembakaran kayu. Menapa kayu yang
terlalu lama dibakar
menjadi hitam/arang?

RUMUSAN MASALAH

Susunlah rumusan masalah yang akan kita pecahkan dalam pembelajaran kali ini!

1. Apa saja keunikan atau kekhasan atom karbon?


2. .....................................................................................................................
.....................................................................................................................

MENGAJUKAN
HIPOTESIS

Berdasarkan rumusan masalah yang kalian susun, tulislah hipotesisnya!

1. ........................................................................................................................................................
2. ........................................................................................................................................................
MENGUMPULKAN DATA

Lengkapilah titik-titik di bawah ini!

Atom karbon memiliki nomor atom......... dengan konfigurasi elektron..........

Atom karbon mempunyai elektron valensi sebanyak...... terletak digolongan......

periode........ struktur lewisnya adalah................... rumus struknya adalah..........................

Sehingga atom karbon mempunyai tangan sebanyak.............

Senyawa hidrokarbon adalah senyawa yang terdiri dari.................. dan .......................

Karena tersusun dari atom hidrogen dan............... maka senyawa yang terbentuk dinamakan

senyawa..............

Berdasarkan posisi atom C dalam rantai, ada ......... jenis atom karbon, yaitu atom C..............

atom C......................., atom C........................ dan atom C........................

Atom C Primer mengikat..........atom C lain, atom C............... mengikat 2 atom C lain, atom
C................ mengikat..........atom C lain, dan atom C..................mengikat 4 atom C lain.

Tentukan jumlah atom C primer, atom C sekunder, atom C tertier, dan atom C kuartener
pada senyawa berikut ini!

1. CH3-CH(CH3)-C(CH3)2-CH2-CH3

2. CH3-CC-CH(CH3)-CH(C2H5)-CH3

3. CH3-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH3

1. ..........................................................................................................................................

..........................................................................................................................................

2. ..........................................................................................................................................

..........................................................................................................................................

3. ..........................................................................................................................................

..........................................................................................................................................
KESIMPULAN

Kekhasan atom karbon


...........................................................................................................
...........................................................................................................
...........................................................................................................
...........................................................................................................
...........................................................................................................
...........................................................................................................
...........................................................................................................
...........................................................................................................
...........................................................................................................
...........................................................................................................
........
Lampiran 2
LEMBAR KERJA SISWA
MENGIDENTIFIKASI KEBERADAAN UNSUR C, H dan O DALAM

SENYAWA KARBON

Orientasi

Kelompok senyawa yang paling sederhana adalah hidrokarbon, yaitu senyawa karbon
yang tersusun dari atom karbon dan hydrogen. Untuk mengetahui bahwa suatu bahan
merupakan senyawa karbon (Hidrokarbon) dapat dilakukan dengan membakar senyawa
tersebut. Pembakaran yang tidak sempurna terhadap senyawa karbon akan menghasilkan
zat sisa berupa arang (karbon), sedangkan apabila pembakarannya berlangsung sempurna
menghasilkan gas CO2. Keberadaan unsur C dan unsur lainya seperti H dalam senyawa
hidrokarbon dapat ditunjukkan oleh reaksi oksidasi. Oksidasi yang sempurna akan
mengubah unsur C menjadi CO2 dan unsur H menjadi H2O. Keberadaan CO2 akan
memperkeruh larutan kapur akibat adanya pembentukan endapan CaCO3. Sedangkan
keberadaan H2O dapat diketahui dengan menggunakan perubahan warna pada kertas
kobalt klorida dari biru menjadi merah jambu.

Rumusan Masalah
Menurut kalian masalah apa
yang muncul dari
penjelasan di atas?
rumuskan masalah tersebut
dalam bentuk pertanyaan!
Hipotesis

Perkirakan jawaban dari pertanyaan-pertanyaan yang telah kalian dibuat!

Mengumpulkan Data

A. TUJUAN
...........................................................................................................................................
...........................................................................................................................................

B. DASAR TEORI

Keberadaan unsur C dan H dalam senyawa karbon dapat diidentifikasi melalui reaksi
pembakaran yang menghasilkan unsur karbon dan hidrogen. Pembakaran senyawa
organik secara sempurna menghasilkan gas CO2, sedangkan pembakaran tidak sempurna
terhadap senyawa karbon menghasilkan arang atau karbon. Untuk mengidentifikasi unsur
C dan H, kalian harus mengalirkan gas hasil pembakaran dalam air kapur [larutan Ca
(OH)2] sehingga terjadi reaksi:
CO2(g) + Ca(OH)2(aq) CaCO3(s)
Jika gas hasil pembakaran dapat mengeruhkan air kapur, berarti senyawa yang dibakar
merupakan senyawa karbon.

C. ALAT DAN BAHAN


Alat : Bahan:
1. Spatula 1. Gula pasir (sukrosa)
2. Tabung reaksi 2. Serbuk tembaga (II) oksida (CuO)
3. Gelas kimia 3. Air kapur
4. Pembakar spiritus 4. Kertas kobalt klorida
5. Korek api 5. Kapas
D. CARA KERJA
1. Masukkan satu sendok teh gula pasir dalam tabung reaksi.
2. Tutuplah mulut tabung dengan kapas.
3. Panaskan tabung sampai terlihat zat cair mengembun pada dinding tabung.
4. Keluarkan kapas dan zat cair dengan kertas CoCl2 kering.
5. Panaskan tabung yang berisi gula sampai terjadi warna hitam

E. HASIL PENGAMATAN

Zat Yang Dipanaskan Perubahan Pada Tabung Perubahan Kertas


Yang Berisi Zat Kobalt(II) Klorida

Kesimpulan

Apa yang bisa kamu simpulkan dari hasil kegiatan diatas? Tuliskan
kesimpulanmu dibawah ini!
Lampiran
Soal terlampir pada Evaluasi

Lembar obervasi Afektif


Skor
No Aspek afektif yang dinilai
1 2 3 4
1. Kemampuan bertanya dan menyusun
pertanyaan
2. Kemampuan menjawab pertanyaan yang
diajukan guru
3. Kemampuan menghargai pendapat orang lain
4. Kemampuan bekerjasama dengan orang lain

5. Disiplin

6. Jujur dan bertanggung jawab

Keterangan : baik sekali (4); baik(3); cukup (2); kurang(1)


Skor perolehan
Nilai = X 100
Skor Maksimal (24)
Kriteria Nilai
3. = 80 100 : Baik Sekali
4. = 70 79 : Baik
5. = 60 69 : Cukup
6. = <60 : Kurang

Lemar Observasi Psikomotorik


Aspek penilaian Skor Kode siswa
A B C D E F G H I J
Persiapan praktikum 1
2
3
4
Menyiapkan alat dan 1
bahan 2
3
4
Mengamati hasil 1
percobaan 2
3
4
Melakukan Percobaan 1
dan penguasaan 2
prosedur praktikum 3
4
Menarik kesimpulan 1
mengkomunikasikan 2
3
data percobaan 4

Rubrik penilaian Psikomotorik


Aspek Skor Kriteria Penskoran
Persiapan Praktikum 1 Tidak memakai kelengkapan laboratorium apapun
2 Memakai masker
3 Memakai masker dan jas lab
4 Memakai jas lab, masker, dan kaos tangan
Menyiapkan alat 1 Tidak menyiapkan alat dan bahan
dan Bahan 2 Menyiapkan alat dan bahan ketika praktikum dimulai
3 Sebelum praktikum telah menyiapkan alat dan bahan
secara lengkap dengan bantuan guru
4 Sebelum praktikum telah menyiapkan alat dan bahan
secara lengkap tanpa bantuan guru
Merangkai alat 1 Tidak dapat merangkai alat
2 Dapat merangkai alat dengan bantuan teman dan guru
3 Dapat merangakai alat dengan bantuan guru
4 Dapat merangkai alat sendiri
Mengamati hasil 1 Tidak dapat mengamati hasil percobaan
percobaan 2 Tidak teliti dalam mengamati hasil percobaan
3 Mengamati hasil percobaan dengan teliti dan benar
dengan bantuan guru
4 Mengamati hasil percobaan dengan teliti dan benar tanpa
bantuan guru
Melakukan 1 Melakukan percobaan tidak sesuai dengan prosedur
Percobaan dan 2 Dapat melakukan percobaan sesuai prosedur dengan
penguasaan melihat lembar praktikum dan bantuan guru
prosedur praktikum 3 Dapat melakukan percobaan sesuai prosedur dengan
melihat lembar praktikum
4 Dapat melakukan percobaan sesuai prosedur tanpa
melihat lembar praktikum
Kerjasama dan 1 Tidak dapat bekerjasama antar anggota kelompok
kekompakan 2 Hanya bekerja sama dengan satu anggota kelompok
3 Bekerjasama hanya dengan beberapa anggota kelompok
4 Bekerjasama dengan seluruh anggota kelompok
Menarik kesimpulan 1 Tidak dapat membuat kesimpulan
mengkomunikasikan 2 Dapat membuat kesimpulan dengan benar, tetapi kurang
data percobaan lengkap dan tidak berani mengkomunikasikan hasil
pengamatan didepan kelas
3 Dapat membuat kesimpulan dengan benar, lengkap tetapi
tidak berani mengkomunikasikan hasil pengamatan di
depan kelas
4 Dapat membuat kesimpulan dengan benar, lengkap dan
berani mengkomunikasikan hasil pengamatan di depan
kelas
Merapikan alat 1 Tidak membersihkan dan merapikan tempat dan alat
sebelum atau sesudah percobaan
2 Hanya membersihkan dan merapikan tempat dan alat
sebelum percobaan
3 Membersihkan dan merapikan tempat dan alat dengan
sebelum dan sesudah percobaan tetapi kurang bersih dan
kurang rapi
4 Membersihkan dan merapikan tempat dan alat sebelum
dan sesudah percobaan hingga bersih
Menulis laporan 1 Tidak menulis laporan praktikum
2 Menulis laporan praktikum yang sama dengan teman
3 Menulis laporan praktikum mandiri namun tidak
sistematis
4 Menulis laporan mandiri dengan runtut dan sistematis

Skor perolehan
Nilai = -- - - - - - - X 100
Skor Maksimal (20)
Kriteria Nilai
7. = 80 100 : Baik Sekali
8. = 70 79 : Baik
9. = 60 69 : Cukup
10. = <60 : Kurang

Demak, Juli 2017

Mengetahui
Kepala SMA N 1 Demak Guru mata pelajaran

Suntono, S.Pd. M.Pd. Sri Astuti, S.Pd.


NIP 19631110 1994121003 NIP 19650113 1990032003