1 Which of the following statements about chemical equilibrium are not true?

The equilibrium constant is dependent on temperature.

The equilibrium constant is independent of the concentrations of reactants or products at
certain reaction conditions.
The initial concentrations of reactants and products will affect the equilibrium position.

When starting with only reactants, only the forward reaction will take place until
equilibrium is reached.
When starting with only the products, the reverse reaction rate will exceed the forward
reaction rate until equilibrium is reached.

2 Which of the following is the correct chemical reaction for the following law of mass
action?

2A(g) + B(g) <==> 3C(g) + D(g)

3A(g) + B(g) <==> 2C(g) + D(g)
C(g) + 2D(g) <==> 3A(g) + B(g)
2C(g) + D(g) <==> 3A(g) + B(g)

3 Which of the following is the correct chemical reaction for the following law of mass
action?

A(s) + B(g) <==> 2 C(g) + D(g)

2A(s) + B(g) <==> 2 C(s) + D(g)
A(g) + 2B(g) <==> 2 C(g) + D(g)
A(s) + B(g) <==> 2C(g) + D(s)

4 What is the equilibrium expression for the following reaction?

CuSO4(s) + 5 H2O(g) <==> CuSO4·5H2O(s)
K = [CuSO4][H2O]5/[CuSO4][H2O]5
K = [H2O]5
K = 1/[H2O]5
K = [CuSO4]/[H2O]5
5 A certain reaction that has the equation A(g) + 2B(g) <==> 3C(g) has a K value of X.
What is the value of KP at the same reaction conditions?
X
X2
2X
square root of X

6 The reaction A(g) <==> B(g) has a K value of 3.2 x 102. At equilibrium, which of the
following would be true?
[A] = [B]
[A] < [B]
[A] > [B]

7 Which of the following statements are true for a reaction with a very small equilibrium
constant?
The equilibrium position lies far to the right.
The equilibrium position lies far to the left.
The reaction will proceed rapidly to the equilibrium position upon the combination of
reactants.
The reaction will proceed slowly to the equilibrium position upon the combination of
reactants.
Two of the above.

8 If the reaction 2A(g) + B(g) <==> 3C(g) was changed to 3C(g) <==> 2A(g) + B(g) at
the same conditions, what would the value of KP be?
2X
X2
1/X
square root of X

9 The reaction 2A(g) <==> B(g) has a K value of 4. What is the value of K for the
reaction
½B(g) <==> A(g)
2
8
.5
.25
 .125

10 The reaction 2A(g) <==> B(g) has a K value of 4.0 when 2.00 mol of A and 4.00 mol of
B are added to a 2.0 L vessel. What is the value of K when 2.00 mol of A and 4.00 mol of
B are added to a 1.0 L vessel at the same temperature?
36
16
8.0
4.0
.2.0

11 Which of the following correctly equilibrium expressions uses the law of mass action
correctly for the equation 2SO2(g) + O2(g) <==> 2 SO3(g) ?
K = [SO3]/[SO2][O2]
K = [SO3]2/[SO2]2[O2]
K = [SO2]2[O2]/[SO3]2
K = [SO2]2/[SO3]2[O2]

12 For a reaction which has a an equilibrium constant (K) value of 2.3 x 1012, which of the
following statements are true?
At equilibrium the forward reaction is faster than the reverse reaction.
The reaction will proceed rapidly from the initial concentrations to equilibrium.
At equilibrium the concentrations of the products are greater than the concentration of the
reactants.
The value of K would double if the concentrations of the products were doubled.

13 The equilibrium concentrations for the reaction N2O4(g) <==> 2 NO2 at a certain
temperature are [N2O4] = 3.50 x 10-3 and [NO2] = 1.40 x 10-3. What is the value of K at
this temperature?
2.4 x 10-3 mol/L
5.1 x 10-3 mol/L
8.8 x 10-3 mol/L
5.6 x 10-4 mol/L
8.1 x 10-4 mol/L

14 One mole of gas A is placed in a one liter vessel and it decomposes into the gaseous
products C and D according to the equation 2A(g) <==> B(g) + C(g). If it is 20.0%
dissociated at equilibrium, what is the value of the equilibrium constant?
 .00320
.00640
.0128
.0156

15 The reaction H2(g) + I2(g) <==> 2 HI(g) has a K value of 244 at a certain temperature.
If the concentration of H2 is .050 M and I2 is .025 M at equilibrium , what is the
concentration of HI at equilibrium?
.95 M
.55 M
.12 M
.087 M
.035 M

16 At a 127 ºC the reaction 3H2(g) + N2(g) <==>2NH3(g) has a K of 3.8 x 104 L2/Lmol2.
What is the value of KP at this temperature?
22/atm2
35/atm2
43/atm2
82/atm2

17 A reaction has the equation 2A(g) + 3B(g) <==> 2C(g) at equilibrium. which of the
following is the correct expression for the relationship between K and KP? (choose two)

K = KP
KP = K(RT)3
KP = K(RT)-3
K = KP(RT)3

18 A certain reaction occurs by the equation 2A(g) + B(g) <==> C(g) + 2D(g) has an
equilibrium constant (K) of 2.3 x 10-3 at 300. K. What is the value of KP for this reaction
at 300. K?
less than 2.3 x 10-3
greater than 2.3 x 10-3
equal to 2.3 x 10-3
insufficient information given
19 A certain reaction occurs by the equation A(g) + B(g) <==> 2C(g) + 2D(g) has an
equilibrium constant (K) of 4.3 x 10-5 M2 at 200. K. What is the value of KP for this
reaction at 200. K?
.012 atm2
3.5 x 10-3 atm2
7.1 x 10-3 atm2
2.1 x 10-4 atm2

20 The reaction A(g) + B(g) <==> 2C(g) has a KP value of 62.0 at 800. K. At equilibrium in
a 2.0 L vessel the partial pressure of C was found to be 3.20 atm and the partial
pressure of A was .15 atm. What is the partial pressure of B?
.98 atm
1.1 atm
1.4 atm
1.6 atm

21 A certain reaction that has the equilibrium equation A(g) + B(g) <==> 2C(g) has an
equilibrium constant value of .085 at 293 K. If 2.0 moles of A and 2.0 moles of B are
placed in a 2.0 L vessel at 293, what will the equilibrium concentration of C be?
.25 M
.44 M
.66 M
.88 M
none of the above

22 A certain reaction that has the equilibrium equation 2A(g) + B(g) <==> C(g) has an
equilibrium constant value of 1.3 x 10-8 at 293 K. If 4.0 moles of A and 2.0 moles of B
are placed in a 1.0 L vessel at 293, what will the equilibrium concentration of C be?

2.3 x 10-5 M
1.9 x 10-6 M
8.8 x 10-6 M
4.2 x 10-7 M

23 A certain reaction that has the equilibrium equation A(g) + B(g) <==> 2C(g) has an
equilibrium constant value of .120 at 293 K. If .200 moles of A, B and C are placed in a
1.0 L vessel at 293, what will the equilibrium concentration of C be?
.303 M
 .285 M
.155 M
.103 M
.0884 M

24 A certain reaction that has the equilibrium equation A(g) + B(g) <==> 2C(g) has an
equilibrium constant value of .455 at 293 K. If 2.00 moles of A, 3.00 moles of B and 3.00
moles of C are placed in a 1.0 L vessel at 293, what will the equilibrium concentration
of C be?
1.50 M
2.00 M
2.30 M
2.80 M
3.10 M

25 For the following reaction KP = 1.25 atm at 700. ºC.

A(s) <==> B(s) + C(g)

How many moles of A will remain if 5.00 moles of A(s) are placed into a 5.00 L vessel
and heated to 700. ºC?
4.92
3.78
2.55
2.00